[GUEST ACCESS MODE: Data is scrambled or limited to provide examples. Make requests using your API key to unlock full data. Check https://lunarcrush.ai/auth for authentication information.]

Top XX Cryptocurrencies in Exchange Tokens by Market Cap

| Coin                                      | Market Cap       |
| ----                                      | ----------       |
| [BNB (BNB)](/topic/binance-coin)          | $XXXXXXXXXXXXXXX |
| [Stellar (XLM)](/topic/$xlm)              | $XXXXXXXXXXXXXX  |
| [LEO Token (LEO)](/topic/leo-token)       | $XXXXXXXXXXXXX   |
| [Uniswap (UNI)](/topic/$uni)              | $XXXXXXXXXXXXX   |
| [Cryptonex (CNX)](/topic/$cnx)            | $XXXXXXXXXXXXX   |
| [Bitget Token (BGB)](/topic/bitget-token) | $XXXXXXXXXXXXX   |
| [Cronos (CRO)](/topic/cronos)             | $XXXXXXXXXXXXX   |
| [OKB (OKB)](/topic/okb)                   | $XXXXXXXXXXXXX   |
| [GateToken (GT)](/topic/gatetoken)        | $XXXXXXXXXXXXX   |
| [Jupiter (JUP)](/topic/$jup)              | $XXXXXXXXXXXXX   |


# Stellar 
[Stellar](/topic/$xlm) 
Stellar ($xlm) is gaining attention for its potential in cross-border payments and financial inclusion. A significant development is the tokenization of a $XXXXX million U.S. government money fund on the Stellar network by Franklin Templeton. Additionally, there are expectations that $xlm will play a key role in the future of finance, with some enthusiasts predicting it will become a global utility. 

### Price: $XXXXX [#](/topic/$xlm/close) 
--- 
The current price action of $XLM is supported by increased institutional interest, strong trading volume, positive sentiment, and high engagement on social media, driven by PayPal integration and Nasdaq's inclusion of XLM in its crypto index. With the price action indicating a breakout above key resistance, the next target could be $XXXX and potentially higher.   
 
| 1-Hour | 24-Hour | 7-Day   | 30-Day |
| ------ | ------- | -----   | ------ |
| -XXXX% | -XXXX%  | -XXXXX% | XXXXX% |
 
**1-Year High**: $XXXXX on 2024-11-24   
**1-Year Low**: $XXXXX on 2024-09-06   
   
   
### AltRank: XXX [#](/topic/$xlm/alt_rank) 
--- 
Stellar (XLM) is currently AltRank #733 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +528   
**1 Month**: XXX +261   
**6 Months**: XXX -X   
**1 Year**: XXX +519   
**1-Year High**: XXXXX on 2025-06-26   
**1-Year Low**: X on 2024-11-16   
   
   
### Galaxy Score: XXXXX [#](/topic/$xlm/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX -XX   
**6 Months**: XX -X   
**1 Year**: XX -X   
**1-Year High**: XX on 2025-05-08   
**1-Year Low**: XX on 2024-08-18   
   
   
### Engagements: XXXXXXX [#](/topic/$xlm/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX -XX%   
**1 Month**: XXXXXXXXXX +98%   
**6 Months**: XXXXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXXX +136%   
**1-Year High**: XXXXXXXXX on 2024-12-02   
**1-Year Low**: XXXXXXX on 2024-10-05   
 
| Social Network | X       | TikTok | YouTube | Reddit |
| -------------- | -       | ------ | ------- | ------ |
| Engagements    | XXXXXXX | XXX    | XXXXX   | X      |
  
 
   
   
### Mentions: XXXXX [#](/topic/$xlm/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX -XXXX%   
**1 Month**: XXXXXX +61%   
**6 Months**: XXXXXXX -XXXX%   
**1 Year**: XXXXXXX +67%   
**1-Year High**: XXXXXX on 2024-11-24   
**1-Year Low**: XXX on 2024-10-06   
 
| Social Network | X     | TikTok | YouTube | Reddit |
| -------------- | -     | ------ | ------- | ------ |
| Mentions       | XXXXX | XX     | XX      | X      |
  
 
   
   
### Creators: XXXXX [#](/topic/$xlm/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Stellar (XLM) in the last XX hours which is up XXXX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX -XX%   
**1 Month**: XXXXX +53%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXX +40%   
**1-Year High**: XXXXX on 2024-11-25   
**1-Year Low**: XXX on 2024-10-06   
 
The most influential creators that mention Stellar in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@sprquy](/creator/twitter/sprquy)                   | X    | XXXXXX    | XX    | XXXXXXX     |
| [@Xfinancebull](/creator/twitter/Xfinancebull)       | X    | XXXXXX    | X     | XXXXXX      |
| [@CRYPTO_GLOBAL10](/creator/twitter/CRYPTO_GLOBAL10) | X    | XXXXX     | XXX   | XXXXXX      |
| [@RealAllinCrypto](/creator/twitter/RealAllinCrypto) | X    | XXXXXX    | XX    | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)       | X    | XXXXX     | XX    | XXXXXX      |
| [@Oficial__odds](/creator/twitter/Oficial__odds)     | X    | XXX       | XX    | XXXXXX      |
| [@CorX2025](/creator/twitter/CorX2025)               | X    | XXX       | XX    | XXXXXX      |
| [@bingerloud](/creator/twitter/bingerloud)           | X    | XXX       | XX    | XXXXXX      |
| [@thebu11runner](/creator/twitter/thebu11runner)     | X    | XXXXXX    | X     | XXXXXX      |
| [@PeterLBrandt](/creator/twitter/PeterLBrandt)       | XX   | XXXXXXX   | X     | XXXXXX      |
 
[View More](/list/creators/$xlm/100) 
   
   
### Sentiment: XX% [#](/topic/$xlm/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% no change   
**1-Year High**: XX% on 2025-01-14   
**1-Year Low**: XX% on 2025-02-09   
 
**Most Supportive Themes** 
- **Real-World Asset (RWA) Tokenization:** (35%) Stellar's increasing role in Real-World Asset (RWA) tokenization is driving increased institutional adoption and partnerships. 
- **Institutional Adoption and Partnerships:** (30%) Increasing institutional interest in Stellar is evident through partnerships and the SEC's approval of a Nasdaq crypto index including XLM. 
- **Focus on Global Payments and Financial Inclusion:** (20%) Stellar's effectiveness in cross-border payments and promoting financial inclusion is frequently highlighted. 
   
**Most Critical Themes** 
- **Scam Warnings and Project Concerns:** (3%)  Posts warning against potential scams within the Stellar ecosystem. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %   |
| ------- | -------- | -   | ------- | -   | -------- | -   |
| X       | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXXX  | XX% |
| TikTok  | XXX      | X%  | XXX     | X%  | XX       | X%  |
| YouTube | XXX      | X%  | XXX     | X%  | XXXXX    | X%  |
| Reddit  | X        | X%  | X       | X%  | X        | X%  |
|         |          |     |         |     |          |     |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXXX  | XX% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/$xlm/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% -XXXXX%   
**1 Month**: XXXXX% +0.372%   
**6 Months**: XXXXX% +0.238%   
**1 Year**: XXXXX% +0.31%   
**1-Year High**: XXXXX% on 2024-11-23   
**1-Year Low**: XXXXX% on 2024-10-13   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/$xlm/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX -$56%   
**1 Month**: $XXXXXXXXXXX +$405%   
**6 Months**: $XXXXXXXXXXX +$39%   
**1 Year**: $XXXXXXXXXXX +$924%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-11-24   
**1-Year Low**: $XXXXXXXXXX on 2024-08-31   
   
   
### Market Dominance: XXXXX% [#](/topic/$xlm/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2024-11-24   
**1-Year Low**: XXXXX% on 2024-10-31   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/$xlm/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX -$11%   
**1 Month**: $XXXXXXXXXXXXXX +$78%   
**6 Months**: $XXXXXXXXXXXXXX +$9.50%   
**1 Year**: $XXXXXXXXXXXXXX +$351%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-11-24   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXXXXXX [#](/topic/$xlm/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXXX on 2025-07-01   
**1-Year Low**: XXXXXXXXXXXXXX on 2024-07-29  

# BNB 
[BNB](/topic/binance-coin) 
BNB has reached a new all-time high, with its market capitalization surpassing that of Nike. The surge is driven by strong institutional inflows, a significant increase in on-chain transactions, and a substantial rise in DEX volume. Additionally, a new publicly listed BNB treasury is set to launch on NASDAQ, further solidifying its presence in the market. 

### Price: $XXX [#](/topic/binance-coin/close) 
--- 
BNB's price is experiencing upward pressure due to positive news, an increase in trading volume, and bullish sentiment. The recent token burn, and Binance's staking opportunities contribute to the positive market reaction, likely leading to further price increases in the short term.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| -XXXX% | XXXX%   | XXXX% | XXXXX% |
 
**1-Year High**: $XXXXXX on 2025-07-27   
**1-Year Low**: $XXXXXX on 2024-08-05   
   
   
### AltRank: XX [#](/topic/binance-coin/alt_rank) 
--- 
BNB (BNB) is currently AltRank #89 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: X -XXX   
**1 Month**: X -XXX   
**6 Months**: X -XXX   
**1 Year**: X -XX   
**1-Year High**: XXXXX on 2025-04-23   
**1-Year Low**: X on 2025-02-16   
   
   
### Galaxy Score: XXXXX [#](/topic/binance-coin/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX +16   
**1 Month**: XX +28   
**6 Months**: XX +12   
**1 Year**: XX +17   
**1-Year High**: XX on 2025-03-24   
**1-Year Low**: XX on 2025-05-30   
   
   
### Engagements: XXXXXXXXX [#](/topic/binance-coin/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +107%   
**1 Month**: XXXXXXXXXX +13%   
**6 Months**: XXXXXXXXXXX +23%   
**1 Year**: XXXXXXXXXXX -XX%   
**1-Year High**: XXXXXXXXX on 2024-12-04   
**1-Year Low**: XXXXXXX on 2024-08-09   
 
| Social Network | X         | TikTok | YouTube | Reddit | News    |
| -------------- | -         | ------ | ------- | ------ | ----    |
| Engagements    | XXXXXXXXX | XXXXX  | XXXXXX  | XX     | XXXXXXX |
  
 
   
   
### Mentions: XXXXXX [#](/topic/binance-coin/posts_active) 
--- 
**Current Value**: XXXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +18%   
**1 Month**: XXXXXX +9.30%   
**6 Months**: XXXXXXX -X%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2024-09-08   
 
| Social Network | X      | TikTok | YouTube | Reddit | News |
| -------------- | -      | ------ | ------- | ------ | ---- |
| Mentions       | XXXXXX | XX     | XXX     | XXX    | XX   |
  
 
   
   
### Creators: XXXXX [#](/topic/binance-coin/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning BNB (BNB) in the last XX hours which is up XX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +24%   
**1 Month**: XXXXXX +24%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2024-09-08   
 
The most influential creators that mention BNB in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@BNBCHAIN](/creator/twitter/BNBCHAIN)               | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@Cointelegraph](/creator/twitter/Cointelegraph)     | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@WhaleInsider](/creator/twitter/WhaleInsider)       | X    | XXXXXXX   | X     | XXXXXXX     |
| [@theunipcs](/creator/twitter/theunipcs)             | X    | XXXXXXX   | X     | XXXXXXX     |
| [@AltcoinDaily](/creator/twitter/AltcoinDaily)       | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@RoundtableSpace](/creator/twitter/RoundtableSpace) | X    | XXXXXXX   | X     | XXXXXXX     |
| [@CashIsTrash_](/creator/twitter/CashIsTrash_)       | X    | XXXXX     | X     | XXXXXXX     |
| [@rubi_click](/creator/twitter/rubi_click)           | X    | XXXXXX    | X     | XXXXXXX     |
| [@yzilabs](/creator/twitter/yzilabs)                 | X    | XXXXXXX   | X     | XXXXXXX     |
| [@MarcShawnBrown](/creator/twitter/MarcShawnBrown)   | XX   | XXXXXX    | X     | XXXXXX      |
 
[View More](/list/creators/binance-coin/100) 
   
   
### Sentiment: XX% [#](/topic/binance-coin/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% +2%   
**6 Months**: XX% +2%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2025-02-15   
**1-Year Low**: XX% on 2025-04-18   
 
**Most Supportive Themes** 
- **Bullish Momentum and Positive Sentiment:** (45%) Posts express optimism about BNB's potential, highlighting its strong performance, increased DEX volume, and positive technical indicators. 
- **Ecosystem Growth and New Opportunities:** (30%) Posts highlight the expanding Binance ecosystem, including new Launchpool projects and the integration of BNB Chain with various platforms. 
- **Recognition and Institutional Interest:** (15%) Posts highlight the expanding Binance ecosystem, including new Launchpool projects and the integration of BNB Chain with various platforms. 
   
**Most Critical Themes** 
- **Scam and Security Concerns & Competition and Market Dynamics:** (5%)  Posts express warnings about potential scams, security issues, and competition within the market. 
   
Network engagement breakdown:   
| Network | Positive  | %   | Neutral   | %   | Negative | %  |
| ------- | --------  | -   | -------   | -   | -------- | -  |
| X       | XXXXXXXXX | XX% | XXXXXXXXX | XX% | XXXXXXX  | X% |
| TikTok  | XXX       | X%  | XXXXX     | X%  | X        | X% |
| YouTube | XXXXX     | X%  | XXXXX     | X%  | XXX      | X% |
| Reddit  | XX        | X%  | XX        | X%  | X        | X% |
| News    | XXX       | X%  | XXXXXXX   | X%  | X        | X% |
|         |           |     |           |     |          |    |
| Total   | XXXXXXXXX | XX% | XXXXXXXXX | XX% | XXXXXXX  | X% |
  
 
   
   
### Social Dominance: XXXX% [#](/topic/binance-coin/social_dominance) 
--- 
**Current Value**: XXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXX% +0.579%   
**1 Month**: XXXX% +0.616%   
**6 Months**: XXXX% +0.517%   
**1 Year**: XXXX% +0.348%   
**1-Year High**: XXXX% on 2025-02-15   
**1-Year Low**: XXXXX% on 2025-07-01   
   
   
### Trading Volume: $XXXXXXXXXXXXX [#](/topic/binance-coin/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$31%   
**1 Month**: $XXXXXXXXXXXXX +$216%   
**6 Months**: $XXXXXXXXXXXXX +$119%   
**1 Year**: $XXXXXXXXXXXXX +$156%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-12-04   
**1-Year Low**: $XXXXXXXXXXX on 2025-06-29   
   
   
### Market Dominance: X% [#](/topic/binance-coin/market_dominance) 
--- 
**Current Value**: X%   
**Daily Average**: X%   
**1-Year High**: X% on 2024-08-23   
**1-Year Low**: XXXX% on 2025-02-04   
   
   
### Market Cap: $XXXXXXXXXXXXXXX [#](/topic/binance-coin/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXXX +$4.50%   
**1 Month**: $XXXXXXXXXXXXXXX +$23%   
**6 Months**: $XXXXXXXXXXXXXXX +$19%   
**1 Year**: $XXXXXXXXXXXXXXX +$30%   
**1-Year High**: $XXXXXXXXXXXXXXX on 2025-07-27   
**1-Year Low**: $XXXXXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/binance-coin/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-29   
**1-Year Low**: XXXXXXXXXXX on 2025-07-28  

# LEO Token 
[LEO Token](/topic/leo-token) 
LEO Token is facing scrutiny due to a DOJ suit and illiquidity concerns, despite being a top gainer. Community sentiment is mixed, with both positive and negative themes emerging in recent social posts. 

### Price: $X [#](/topic/leo-token/close) 
--- 
The price of LEO Token is likely decreasing due to negative price action, the -XXXX% 24-hour change, and concerns about illiquidity despite the recent mention as a top gainer.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| -XXXX% | -XXXX%  | -XXXX% | -XXXX% |
 
**1-Year High**: $XXXX on 2025-03-07   
**1-Year Low**: $XXXX on 2024-09-07   
   
   
### AltRank: XXXXX [#](/topic/leo-token/alt_rank) 
--- 
LEO Token (LEO) is currently AltRank #3,051 based on combined combined social and market metrics 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +876   
**1 Month**: XXXXX +286   
**6 Months**: XXXXX -XXX   
**1 Year**: XXXXX +1,858   
**1-Year High**: XXXXX on 2025-04-21   
**1-Year Low**: XXX on 2024-08-21   
   
   
### Galaxy Score: XXXXX [#](/topic/leo-token/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX -X   
**6 Months**: XX -XX   
**1 Year**: XX -X   
**1-Year High**: XX on 2025-05-25   
**1-Year Low**: X on 2025-05-09   
   
   
### Engagements: XXX [#](/topic/leo-token/interactions) 
--- 
**Current Value**: XXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXX -XX%   
**1 Month**: XXXXXX -XX%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXXXX -XX%   
**1-Year High**: XXXXXXX on 2024-11-23   
**1-Year Low**: XXX on 2025-07-26   
 
| Social Network | Reddit | X   | YouTube | News | TikTok |
| -------------- | ------ | -   | ------- | ---- | ------ |
| Engagements    | X      | XXX | X       | X    | X      |
  
 
   
   
### Mentions: XX [#](/topic/leo-token/posts_active) 
--- 
**Current Value**: XX   
**Daily Average**: XX   
**1 Week**: XXX +4.80%   
**1 Month**: XXX -XX%   
**6 Months**: XXXXX +3.70%   
**1 Year**: XXXXX +4.30%   
**1-Year High**: XXX on 2024-12-02   
**1-Year Low**: XX on 2025-01-26   
 
| Social Network | Reddit | X  | YouTube | News | TikTok |
| -------------- | ------ | -  | ------- | ---- | ------ |
| Mentions       | XX     | XX | XX      | X    | X      |
  
 
   
   
### Creators: XX [#](/topic/leo-token/contributors_active) 
--- 
XX unique social accounts have posts mentioning LEO Token (LEO) in the last XX hours which is down XXXX% from XX in the previous XX hours 
**Daily Average**: XX   
**1 Week**: XX +2.20%   
**1 Month**: XXX -XXXX%   
**6 Months**: XXX -XX%   
**1 Year**: XXXXX -XX%   
**1-Year High**: XX on 2024-12-02   
**1-Year Low**: XX on 2025-01-14   
   
   
### Sentiment: XX% [#](/topic/leo-token/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -XX%   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XXX% on 2024-08-12   
**1-Year Low**: XX% on 2025-05-23   
 
**Most Supportive Themes** 
- **Empowering the Bitfinex Community:** (50%) LEO Token is highlighted for its role in empowering the Bitfinex community. 
- **Top Performer Recognition:** (50%) LEO Token is recognized as a top gainer, attracting attention. 
   
**Most Critical Themes** 
- **Illiquidity Concerns:** (56%)  Concerns about illiquidity are being expressed by users, potentially leading to price drops. 
- **Labeled as 'Useless':** (44%)  Some users are skeptical about LEO Token's value proposition, labeling it as 'useless'. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| Reddit  | X        | X%  | X       | X%  | X        | X% |
| X       | XXX      | XX% | XX      | XX% | XX       | X% |
| YouTube | X        | X%  | X       | X%  | X        | X% |
| News    | X        | X%  | X       | X%  | X        | X% |
| TikTok  | X        | X%  | X       | X%  | X        | X% |
|         |          |     |         |     |          |    |
| Total   | XXX      | XX% | XX      | XX% | XX       | X% |
  
 
   
   
### Social Dominance: XXXXXXX% [#](/topic/leo-token/social_dominance) 
--- 
**Current Value**: XXXXXXX%   
**Daily Average**: XXXXXXX%   
**1 Week**: XXXXXXX% +0.00266%   
**1 Month**: XXXXXX% -XXXXXX%   
**6 Months**: XXXXXX% -XXXXXX%   
**1 Year**: XXXXXX% -XXXXXX%   
**1-Year High**: XXXXX% on 2024-10-10   
**1-Year Low**: XXXXXX% on 2025-01-14   
   
   
### Trading Volume: $XXXXXXXXX [#](/topic/leo-token/volume_24h) 
--- 
**Current Value**: $XXXXXXXXX   
**Daily Average**: $XXXXXXXXX   
**1 Week**: $XXXXXXXXX -$53%   
**1 Month**: $XXXXXXXXX +$195%   
**6 Months**: $XXXXXXXXX +$574%   
**1 Year**: $XXXXXXXXX +$166%   
**1-Year High**: $XXXXXXXXXX on 2025-06-14   
**1-Year Low**: $XXXXXXX on 2025-01-26   
   
   
### Market Dominance: XXXXX% [#](/topic/leo-token/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-04-09   
**1-Year Low**: XXXXX% on 2025-07-23   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/leo-token/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX -$0.18%   
**1 Month**: $XXXXXXXXXXXXX -$1.30%   
**6 Months**: $XXXXXXXXXXXXX -$8.50%   
**1 Year**: $XXXXXXXXXXXXX +$53%   
**1-Year High**: $XXXXXXXXXXXXX on 2025-03-07   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-09-09   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/leo-token/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-29   
**1-Year Low**: XXXXXXXXXXX on 2025-07-17  

# Cryptonex 
[Cryptonex](/topic/$cnx) 
Cryptonex (CNX) reports mixed Q2 2025 earnings, with positive EPS growth but a revenue miss. Social engagement is down, but positive sentiment and market dominance near a 52-week high offer some support. 

### Price: $XXXXX [#](/topic/$cnx/close) 
--- 
The current price of $XXXXX is likely experiencing a slight decrease due to mixed earnings results, decreased engagements, and neutral sentiment, despite positive sentiment and market dominance near a 52-week high.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| -XXXX% | -XXXX%  | XXXX% | XXXX%  |
 
**1-Year High**: $XXXXX on 2025-07-14   
**1-Year Low**: $XXXXX on 2024-09-06   
   
   
### AltRank: XXXXX [#](/topic/$cnx/alt_rank) 
--- 
Cryptonex (CNX) is currently AltRank #2,910 based on combined combined social and market metrics 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +138   
**1 Month**: XXXXX +1,402   
**6 Months**: XXXXX +2,809   
**1-Year High**: XXXXX on 2025-04-08   
**1-Year Low**: XXX on 2024-08-21   
   
   
### Galaxy Score: XXXXX [#](/topic/$cnx/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX +13   
**1 Month**: XX -XX   
**6 Months**: XX -XX   
**1-Year High**: XX on 2025-06-09   
**1-Year Low**: X on 2025-06-04   
   
   
### Engagements: XXX [#](/topic/$cnx/interactions) 
--- 
**Current Value**: XXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXXX +1,834%   
**1 Month**: XXXXXXX +305%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXXXX +29%   
**1-Year High**: XXXXXXX on 2025-01-22   
**1-Year Low**: XXX on 2025-06-08   
 
| Social Network | X   | YouTube |
| -------------- | -   | ------- |
| Engagements    | XXX | X       |
  
 
   
   
### Mentions: XX [#](/topic/$cnx/posts_active) 
--- 
**Current Value**: XX   
**Daily Average**: XX   
**1 Week**: XXX -XXXX%   
**1 Month**: XXX +41%   
**6 Months**: XXXXX -XXXX%   
**1 Year**: XXXXX +178%   
**1-Year High**: XXX on 2025-01-23   
**1-Year Low**: X on 2024-09-15   
 
| Social Network | X  | YouTube |
| -------------- | -  | ------- |
| Mentions       | XX | X       |
  
 
   
   
### Creators: XX [#](/topic/$cnx/contributors_active) 
--- 
XX unique social accounts have posts mentioning Cryptonex (CNX) in the last XX hours which is up XX% from XX in the previous XX hours 
**Daily Average**: XX   
**1 Week**: XX -XX%   
**1 Month**: XXX +61%   
**6 Months**: XXXXX +16%   
**1 Year**: XXXXX +253%   
**1-Year High**: XXX on 2025-06-28   
**1-Year Low**: X on 2024-09-15   
 
The most influential creators that mention Cryptonex in the last XX hours 
 
| Creator                                          | Rank | Followers | Posts | Engagements |
| -------                                          | ---- | --------- | ----- | ----------- |
| [@TradesProfits](/creator/twitter/TradesProfits) | X    | XXX       | X     | XXX         |
 
[View More](/list/creators/$cnx/100) 
   
   
### Sentiment: XX% [#](/topic/$cnx/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XXX% +20%   
**1 Month**: XX% -XX%   
**6 Months**: XX% -X%   
**1 Year**: XX% -XX%   
**1-Year High**: XXX% on 2024-08-03   
**1-Year Low**: XX% on 2025-03-16   
 
**Most Supportive Themes** 
- **Stock Picking Services:** (5%) Multiple stock picking services are mentioning CNX, hinting at potential upward price movement. 
- **Commodity and Energy Sector Strength:** (10%) Posts highlight the positive impact of rising natural gas prices on CNX, indicating positive market forces. 
- **Positive Sentiment:** (43%) Social engagements highlight potential upward price movement and increasing interest in CNX. 
   
**Most Critical Themes** 
- **Decreased Engagements:** (15%)  Decreased engagements reflect slowing social interest, potentially hindering price gains. 
- **Neutral Sentiment:** (56%)  Neutral sentiment suggests a lack of strong opinions, which could hinder price movement. 
   
Network engagement breakdown:   
| Network | Positive | %  | Neutral | %   | Negative | %  |
| ------- | -------- | -  | ------- | -   | -------- | -  |
| X       | XX       | X% | XXX     | XX% | X        | X% |
| YouTube | X        | X% | X       | X%  | X        | X% |
|         |          |    |         |     |          |    |
| Total   | XX       | X% | XXX     | XX% | X        | X% |
  
 
   
   
### Social Dominance: XXXXXXX% [#](/topic/$cnx/social_dominance) 
--- 
**Current Value**: XXXXXXX%   
**Daily Average**: XXXXXXX%   
**1 Week**: XXXXXXX% +0.00138%   
**1 Month**: XXXXXX% -XXXXX%   
**6 Months**: XXXXXX% -XXXXX%   
**1 Year**: XXXXXX% -XXXXXX%   
**1-Year High**: XXXXX% on 2025-01-28   
**1-Year Low**: XXXXXX% on 2024-09-15   
   
   
### Trading Volume: $XXXXXXXXX [#](/topic/$cnx/volume_24h) 
--- 
**Current Value**: $XXXXXXXXX   
**Daily Average**: $XXXXXXXXXX   
**1 Week**: $XXXXXXXXX -$25%   
**1 Month**: $XXXXXXXXX +$494%   
**6 Months**: $XXXXXXXXX -$53%   
**1 Year**: $XXXXXXXXX +$54%   
**1-Year High**: $XXXXXXXXXX on 2024-08-05   
**1-Year Low**: $XXXXXXXX on 2025-07-04   
   
   
### Market Dominance: XXXXX% [#](/topic/$cnx/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-05-06   
**1-Year Low**: XXXXX% on 2024-12-05   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/$cnx/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$0.68%   
**1 Month**: $XXXXXXXXXXXXX +$11%   
**6 Months**: $XXXXXXXXXXXXX +$15%   
**1 Year**: $XXXXXXXXXXXXX +$74%   
**1-Year High**: $XXXXXXXXXXXXX on 2025-07-14   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-09-06   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/$cnx/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-29   
**1-Year Low**: XXXXXXXXXXX on 2024-07-29  

# Bitget Token 
[Bitget Token](/topic/bitget-token) 
Bitget Token is surging due to exchange partnerships and a bullish technical setup. The community is buzzing about the token's performance and potential, despite some bubble concerns. 

### Price: $XXXX [#](/topic/bitget-token/close) 
--- 
The price of Bitget Token is experiencing bullish momentum, up XXXX% in the last XX hours, fueled by positive sentiment and announcements, especially the Q2 2025 token burn and strong trading volume. The recent partnership news and store launch are also contributing to the positive price action.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| XXXX%  | XXXX%   | -XXXX% | XXXX%  |
 
**1-Year High**: $XXXX on 2024-12-27   
**1-Year Low**: $XXXXX on 2024-08-07   
   
   
### AltRank: XXXXX [#](/topic/bitget-token/alt_rank) 
--- 
Bitget Token (BGB) is currently AltRank #1,540 based on combined combined social and market metrics 
**Daily Average**: XXXXX   
**1 Week**: XXXXX -XXXXX   
**1 Month**: XXXXX -XXXXX   
**6 Months**: XXXXX -XXXXX   
**1 Year**: XXXXX +1,035   
**1-Year High**: XXXXX on 2025-07-12   
**1-Year Low**: XX on 2024-10-08   
   
   
### Galaxy Score: XXXXX [#](/topic/bitget-token/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX +6   
**1 Month**: XX +19   
**6 Months**: XX -XX   
**1 Year**: XX -XX   
**1-Year High**: XX on 2025-04-28   
**1-Year Low**: X on 2025-05-29   
   
   
### Engagements: XXXXX [#](/topic/bitget-token/interactions) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXXX   
**1 Week**: XXXXXX -XX%   
**1 Month**: XXXXXX +7.40%   
**6 Months**: XXXXXXXXXX +481%   
**1 Year**: XXXXXXXXXX +151%   
**1-Year High**: XXXXXXXXX on 2025-04-09   
**1-Year Low**: XXX on 2025-06-04   
 
| Social Network | X   | TikTok | YouTube | Reddit |
| -------------- | -   | ------ | ------- | ------ |
| Engagements    | XXX | XX     | XXXXX   | X      |
  
 
   
   
### Mentions: XX [#](/topic/bitget-token/posts_active) 
--- 
**Current Value**: XX   
**Daily Average**: XX   
**1 Week**: XXX -XXXX%   
**1 Month**: XXX -XX%   
**6 Months**: XXXXX -XX%   
**1 Year**: XXXXX +8.60%   
**1-Year High**: XXX on 2024-12-27   
**1-Year Low**: XX on 2024-11-22   
 
| Social Network | X  | TikTok | YouTube | Reddit |
| -------------- | -  | ------ | ------- | ------ |
| Mentions       | XX | X      | XX      | XX     |
  
 
   
   
### Creators: XX [#](/topic/bitget-token/contributors_active) 
--- 
XX unique social accounts have posts mentioning Bitget Token (BGB) in the last XX hours which is down XX% from XX in the previous XX hours 
**Daily Average**: XX   
**1 Week**: XX -XXXX%   
**1 Month**: XXX -XXXX%   
**6 Months**: XXX -XX%   
**1 Year**: XXXXX -XX%   
**1-Year High**: XXX on 2024-12-27   
**1-Year Low**: XX on 2024-11-22   
   
   
### Sentiment: XX% [#](/topic/bitget-token/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +17%   
**1 Month**: XX% +8%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XXX% on 2024-08-02   
**1-Year Low**: XX% on 2025-07-20   
 
**Most Supportive Themes** 
- **Bullish Momentum and Price Predictions:** (45%) Posts highlight the recent price surge and predict further increases for Bitget Token. 
- **Benefits and Utility of BGB:** (30%) Posts emphasize the role of Bitget Token in reducing trading fees and providing benefits to holders on the Bitget platform. 
- **Top Performer Recognition:** (20%) Multiple posts identify Bitget Token as a top gainer in the cryptocurrency market. 
   
**Most Critical Themes** 
- **Bubble Concerns:** (5%)  Posts express concerns about a potential price bubble in Bitget Token. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %  | Negative | %  |
| ------- | -------- | -   | ------- | -  | -------- | -  |
| X       | XXX      | X%  | XXX     | X% | XX       | X% |
| TikTok  | X        | X%  | XX      | X% | X        | X% |
| YouTube | XXXXX    | XX% | X       | X% | X        | X% |
| Reddit  | X        | X%  | X       | X% | X        | X% |
|         |          |     |         |    |          |    |
| Total   | XXXXX    | XX% | XXX     | X% | XX       | X% |
  
 
   
   
### Social Dominance: XXXXXXX% [#](/topic/bitget-token/social_dominance) 
--- 
**Current Value**: XXXXXXX%   
**Daily Average**: XXXXXXX%   
**1 Week**: XXXXXXX% +0.00148%   
**1 Month**: XXXXXX% +0.0019%   
**6 Months**: XXXXXX% -XXXXXX%   
**1 Year**: XXXXXX% +0.0016%   
**1-Year High**: XXXXX% on 2024-12-27   
**1-Year Low**: XXXXXX% on 2025-06-24   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/bitget-token/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX +$3.60%   
**1 Month**: $XXXXXXXXXXX +$367%   
**6 Months**: $XXXXXXXXXXX -$24%   
**1 Year**: $XXXXXXXXXXX +$887%   
**1-Year High**: $XXXXXXXXXXX on 2025-01-13   
**1-Year Low**: $XXXXXXXXX on 2025-04-03   
   
   
### Market Dominance: XXXXX% [#](/topic/bitget-token/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2024-12-27   
**1-Year Low**: XXXXX% on 2024-09-21   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/bitget-token/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX -$5.80%   
**1 Month**: $XXXXXXXXXXXXX -$2.50%   
**6 Months**: $XXXXXXXXXXXXX -$35%   
**1 Year**: $XXXXXXXXXXXXX +$239%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-12-27   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-08-07   
   
   
### Circulating Supply: XXXXXXXXXXXXX [#](/topic/bitget-token/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXX on 2024-12-31   
**1-Year Low**: XXXXXXXXXXXXX on 2025-07-28  

# Cronos 
[Cronos](/topic/cronos) 
Cronos (CRO) is seeing increased interest with new listings and developments, but users express concerns about price performance.  The community is buzzing with discussions about the future of CRO and its potential for growth. 

### Price: $XXXX [#](/topic/cronos/close) 
--- 
CRO is currently trading at $0.086, showing negative performance over the past week and month, despite positive news in the ecosystem. This price action is likely due to user concerns regarding the price despite positive developments, compounded by broader market trends.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| -XXXX% | XXXX%   | XXXXX% | XXXXX% |
 
**1-Year High**: $XXXXX on 2024-11-11   
**1-Year Low**: $XXXX on 2024-11-04   
   
   
### AltRank: XX [#](/topic/cronos/alt_rank) 
--- 
Cronos (CRO) is currently AltRank #78 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XX -XXX   
**1 Month**: XX -XXX   
**6 Months**: XX -XXX   
**1 Year**: XX -XXX   
**1-Year High**: XXXXX on 2025-04-23   
**1-Year Low**: X on 2025-07-08   
   
   
### Galaxy Score: XXXXX [#](/topic/cronos/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -X   
**1 Month**: XX +1   
**6 Months**: XX +9   
**1 Year**: XX +12   
**1-Year High**: XX on 2025-03-24   
**1-Year Low**: XX on 2024-08-01   
   
   
### Engagements: XXXXXXXXX [#](/topic/cronos/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +21%   
**1 Month**: XXXXXXXXXX +65%   
**6 Months**: XXXXXXXXXXX +13%   
**1 Year**: XXXXXXXXXXX +23%   
**1-Year High**: XXXXXXXXX on 2025-02-12   
**1-Year Low**: XXXXXXX on 2024-09-07   
 
| Social Network | X         | Reddit | TikTok  | YouTube   | News   |
| -------------- | -         | ------ | ------  | -------   | ----   |
| Engagements    | XXXXXXXXX | XXXXX  | XXXXXXX | XXXXXXXXX | XXXXXX |
  
 
   
   
### Mentions: XXXXX [#](/topic/cronos/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +6.10%   
**1 Month**: XXXXXX +27%   
**6 Months**: XXXXXXX +13%   
**1 Year**: XXXXXXX +23%   
**1-Year High**: XXXXX on 2025-06-25   
**1-Year Low**: XXXXX on 2024-10-05   
 
| Social Network | X     | Reddit | TikTok | YouTube | News |
| -------------- | -     | ------ | ------ | ------- | ---- |
| Mentions       | XXXXX | XXX    | XXX    | XXX     | X    |
  
 
   
   
### Creators: XXXXX [#](/topic/cronos/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Cronos (CRO) in the last XX hours which is up XX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +13%   
**1 Month**: XXXXX +19%   
**6 Months**: XXXXXX -XXXX%   
**1 Year**: XXXXXX -XX%   
**1-Year High**: XXXXX on 2025-07-09   
**1-Year Low**: XXX on 2024-10-03   
 
The most influential creators that mention Cronos in the last XX hours 
 
| Creator                                              | Rank | Followers  | Posts | Engagements |
| -------                                              | ---- | ---------  | ----- | ----------- |
| [@cronostop](/creator/youtube/cronostop)             | X    | XXXXXX     | X     | XXXXXXX     |
| [@CronosNewDawn](/creator/twitter/CronosNewDawn)     | X    | XXXXX      | X     | XXXXXXX     |
| [@redlinegamingz](/creator/youtube/redlinegamingz)   | X    | XXXXXX     | X     | XXXXXXX     |
| [@IGN](/creator/twitter/IGN)                         | X    | XXXXXXXXXX | X     | XXXXXX      |
| [@blooberteamsa](/creator/youtube/blooberteamsa)     | X    | XXXXXX     | X     | XXXXXX      |
| [@ign](/creator/youtube/ign)                         | X    | XXXXXXXXXX | X     | XXXXXX      |
| [@goosebumps099](/creator/youtube/goosebumps099)     | X    | XXXXXX     | X     | XXXXXX      |
| [@shinobi602](/creator/twitter/shinobi602)           | X    | XXXXXXX    | X     | XXXXXX      |
| [@GermanStrands](/creator/twitter/GermanStrands)     | X    | XXXXXX     | X     | XXXXXX      |
| [@Blockchainwork5](/creator/twitter/Blockchainwork5) | XX   | XXXXXX     | XX    | XXXXXX      |
 
[View More](/list/creators/cronos/100) 
   
   
### Sentiment: XX% [#](/topic/cronos/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% -X%   
**6 Months**: XX% +3%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-09-13   
**1-Year Low**: XX% on 2024-10-10   
 
**Most Supportive Themes** 
- **Partnerships and Investment Vehicles:** (35%) Positive developments like BitGo expanding support to Cronos Chain and upcoming events are seen as steps toward mainstream adoption. 
- **Ecosystem Development and Community Engagement:** (30%) Posts reflect optimism regarding ongoing development within the Cronos ecosystem, including new dApps, NFT projects, and opportunities for builders. 
- **Technical Upgrades and DeFi Opportunities:** (10%) Upcoming upgrades to the Cronos zkEVM, combined with DeFi opportunities such as staking, yield farming, and trading contests, generate positive sentiment. 
   
**Most Critical Themes** 
- **Concerns over CRO's Price Performance & Centralization:** (25%)  Users express concerns about CRO's underperformance despite positive developments in the ecosystem. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral   | %   | Negative | %  |
| ------- | -------- | -   | -------   | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXX   | XX% | XXXXXX   | X% |
| Reddit  | XXX      | X%  | XXX       | X%  | XX       | X% |
| TikTok  | XXXXX    | X%  | XXXXXXX   | XX% | XXXXXX   | X% |
| YouTube | XXXXXXX  | XX% | XXXXXXX   | XX% | XXXXXXX  | X% |
| News    | XXXXXX   | X%  | XXXXX     | X%  | X        | X% |
|         |          |     |           |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXXXX | XX% | XXXXXXX  | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/cronos/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.181%   
**1 Month**: XXXXX% +0.203%   
**6 Months**: XXXXX% +0.385%   
**1 Year**: XXXXX% +0.343%   
**1-Year High**: XXXXX% on 2025-07-28   
**1-Year Low**: XXXXX% on 2025-01-10   
   
   
### Trading Volume: $XXXXXXXXXX [#](/topic/cronos/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXX   
**Daily Average**: $XXXXXXXXXX   
**1 Week**: $XXXXXXXXXX +$31%   
**1 Month**: $XXXXXXXXXX +$591%   
**6 Months**: $XXXXXXXXXX +$105%   
**1 Year**: $XXXXXXXXXX +$1,304%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-11-11   
**1-Year Low**: $XXXXXXXXX on 2024-10-05   
   
   
### Market Dominance: XXXXX% [#](/topic/cronos/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2024-11-11   
**1-Year Low**: XXXXX% on 2025-02-24   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/cronos/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$15%   
**1 Month**: $XXXXXXXXXXXXX +$80%   
**6 Months**: $XXXXXXXXXXXXX +$28%   
**1 Year**: $XXXXXXXXXXXXX +$87%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-11-11   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-11-04   
   
   
### Circulating Supply: XXXXXXXXXXXXXX [#](/topic/cronos/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXXX on 2025-07-28   
**1-Year Low**: XXXXXXXXXXXXXX on 2024-07-29  

# OKB 
[OKB](/topic/okb) 
OKB sees positive trading volume and social engagement, but AI price predictions suggest a decline. Despite the negative predictions, OKB is still being promoted with major cryptocurrencies. 

### Price: $XXXXX [#](/topic/okb/close) 
--- 
The price is experiencing negative action, most likely due to negative sentiment from AI price predictions, despite positive trading volume and social engagement.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| -XXXX% | XXXX%   | -XXXX% | -XXXX% |
 
**1-Year High**: $XX on 2024-12-06   
**1-Year Low**: $XXXXX on 2024-08-05   
   
   
### AltRank: XXX [#](/topic/okb/alt_rank) 
--- 
OKB (OKB) is currently AltRank #136 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XX -XXXXX   
**1 Month**: XX -XXXXX   
**6 Months**: XX -XXX   
**1 Year**: XX -XXX   
**1-Year High**: XXXXX on 2024-12-29   
**1-Year Low**: XX on 2025-04-05   
   
   
### Galaxy Score: XXXXX [#](/topic/okb/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX +17   
**1 Month**: XX +15   
**6 Months**: XX +20   
**1 Year**: XX +17   
**1-Year High**: XX on 2025-03-14   
**1-Year Low**: XX on 2025-07-04   
   
   
### Engagements: XXXXXXX [#](/topic/okb/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX +5.30%   
**1 Month**: XXXXXXXXXX +35%   
**6 Months**: XXXXXXXXXX -XXXX%   
**1 Year**: XXXXXXXXXX -XX%   
**1-Year High**: XXXXXXXXX on 2024-08-04   
**1-Year Low**: XXXXXX on 2024-08-03   
 
| Social Network | YouTube | X       | TikTok | Reddit | News |
| -------------- | ------- | -       | ------ | ------ | ---- |
| Engagements    | XXXXXXX | XXXXXXX | XXXXXX | XXX    | X    |
  
 
   
   
### Mentions: XXXXX [#](/topic/okb/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXX   
**1 Week**: XXXXX -XXXX%   
**1 Month**: XXXXX +26%   
**6 Months**: XXXXXX -XXXX%   
**1 Year**: XXXXXX -XX%   
**1-Year High**: XXXXX on 2024-10-17   
**1-Year Low**: XXX on 2024-10-02   
 
| Social Network | YouTube | X     | TikTok | Reddit | News |
| -------------- | ------- | -     | ------ | ------ | ---- |
| Mentions       | XXX     | XXXXX | XXX    | XX     | X    |
  
 
   
   
### Creators: XXX [#](/topic/okb/contributors_active) 
--- 
XXX unique social accounts have posts mentioning OKB (OKB) in the last XX hours which is down XXXX% from XXX in the previous XX hours 
**Daily Average**: XXX   
**1 Week**: XXX +21%   
**1 Month**: XXXXX -XX%   
**6 Months**: XXXXX -XX%   
**1 Year**: XXXXXX -XX%   
**1-Year High**: XXXXX on 2024-10-17   
**1-Year Low**: XXX on 2024-11-06   
 
The most influential creators that mention OKB in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@_okb_art_](/creator/youtube/_okb_art_)             | X    | XXXXXX    | X     | XXXXXXX     |
| [@CRYPTO_GLOBAL10](/creator/twitter/CRYPTO_GLOBAL10) | X    | XXXXX     | XXX   | XXXXXX      |
| [@sedonsfc](/creator/youtube/sedonsfc)               | X    | XXXXXXX   | X     | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)       | X    | XXXXX     | XX    | XXXXX       |
| [@Oficial__odds](/creator/twitter/Oficial__odds)     | X    | XXX       | XX    | XXXXX       |
| [@bingerloud](/creator/twitter/bingerloud)           | X    | XXX       | XX    | XXXXX       |
| [@AdiugriP](/creator/twitter/AdiugriP)               | X    | XXX       | XX    | XXXXX       |
| [@hazegrayart](/creator/youtube/hazegrayart)         | X    | XXXXXXXXX | X     | XXXXX       |
| [@ADVIK_SIGNALS](/creator/twitter/ADVIK_SIGNALS)     | X    | XXX       | X     | XXX         |
| [@DigitalMar81780](/creator/twitter/DigitalMar81780) | XX   | XX        | X     | XXX         |
 
[View More](/list/creators/okb/100) 
   
   
### Sentiment: XX% [#](/topic/okb/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +2%   
**1 Month**: XX% +10%   
**6 Months**: XX% +20%   
**1 Year**: XX% +9%   
**1-Year High**: XX% on 2024-09-08   
**1-Year Low**: XX% on 2024-08-04   
 
**Most Supportive Themes** 
- **General Promotion and Mentions with Top Cryptocurrencies:** (70%) Users are promoting OKB with major cryptocurrencies. 
- **Staking and Positive OKX Experience:** (15%) Enthusiasm is growing for OKB staking on OKX, highlighting a positive user experience. 
   
**Most Critical Themes** 
- **AI Prediction of Decline:** (0.2%)  AI price predictions are suggesting a decline for OKB. 
   
Network engagement breakdown:   
| Network | Positive | %  | Neutral | %   | Negative | %   |
| ------- | -------- | -  | ------- | -   | -------- | -   |
| YouTube | XXXXX    | X% | XXXXXXX | XX% | XXXXXX   | XX% |
| X       | XXXXX    | X% | XXXXXXX | XX% | XXX      | X%  |
| TikTok  | XXX      | X% | XXXXXX  | XX% | XXX      | X%  |
| Reddit  | XXX      | X% | XX      | X%  | X        | X%  |
| News    | X        | X% | X       | X%  | X        | X%  |
|         |          |    |         |     |          |     |
| Total   | XXXXXX   | X% | XXXXXXX | XX% | XXXXXX   | XX% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/okb/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXX%   
**1 Week**: XXXXX% +0.027%   
**1 Month**: XXXXX% +0.015%   
**6 Months**: XXXXX% +0.056%   
**1 Year**: XXXXX% +0.0092%   
**1-Year High**: XXXX% on 2024-10-17   
**1-Year Low**: XXXXX% on 2024-11-19   
   
   
### Trading Volume: $XXXXXXXXXX [#](/topic/okb/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXX   
**Daily Average**: $XXXXXXXXXX   
**1 Week**: $XXXXXXXXXX -$4.40%   
**1 Month**: $XXXXXXXXXX +$508%   
**6 Months**: $XXXXXXXXXX +$34%   
**1 Year**: $XXXXXXXXXX +$653%   
**1-Year High**: $XXXXXXXXXXX on 2025-01-17   
**1-Year Low**: $XXXXXXXXX on 2024-10-06   
   
   
### Market Dominance: XXXXX% [#](/topic/okb/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-04-09   
**1-Year Low**: XXXXX% on 2025-07-23   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/okb/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX -$0.69%   
**1 Month**: $XXXXXXXXXXXXX -$2.70%   
**6 Months**: $XXXXXXXXXXXXX -$11%   
**1 Year**: $XXXXXXXXXXXXX +$20%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-12-06   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXX [#](/topic/okb/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-29   
**1-Year Low**: XXXXXXXXXX on 2025-07-27  

# GateToken 
[GateToken](/topic/gatetoken) 
Gate Launchpad #3 is LIVE: $IKA is now live with over $XXXXXXXXXXX subscribed.  GateToken (GT) Q2 burn is complete, removing nearly X million GT tokens from circulation. 

### Price: $XX [#](/topic/gatetoken/close) 
--- 
The price is experiencing a slight decrease, likely due to some negative sentiment on X, which is counterbalanced by positive catalysts such as increased trading volume and staking incentives that are actively promoted.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| -XXXX% | XXXX%   | XXXX% | XXXXX% |
 
**1-Year High**: $XXXXX on 2025-01-26   
**1-Year Low**: $XXXX on 2024-08-05   
   
   
### AltRank: XXX [#](/topic/gatetoken/alt_rank) 
--- 
GateToken (GT) is currently AltRank #126 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +130   
**1 Month**: XXX -XXX   
**6 Months**: XXX +490   
**1 Year**: XXX +240   
**1-Year High**: XXXXX on 2025-01-28   
**1-Year Low**: X on 2025-06-20   
   
   
### Galaxy Score: XX [#](/topic/gatetoken/galaxy_score) 
--- 
**Current Value**: XX   
**Daily Average**: XX   
**1 Week**: XX -X   
**1 Month**: XX +6   
**6 Months**: XX +22   
**1 Year**: XX +25   
**1-Year High**: XX on 2025-03-12   
**1-Year Low**: XX on 2025-05-30   
   
   
### Engagements: XXXXXXX [#](/topic/gatetoken/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX +152%   
**1 Month**: XXXXXXXXX +1.30%   
**6 Months**: XXXXXXXXXX +14%   
**1 Year**: XXXXXXXXXX +51%   
**1-Year High**: XXXXXXX on 2025-03-10   
**1-Year Low**: XXXXXX on 2025-07-04   
 
| Social Network | X       | Reddit | YouTube | TikTok |
| -------------- | -       | ------ | ------- | ------ |
| Engagements    | XXXXXXX | X      | XXX     | XXX    |
  
 
   
   
### Mentions: XXXXX [#](/topic/gatetoken/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXX   
**1 Week**: XXXXX +12%   
**1 Month**: XXXXX +34%   
**6 Months**: XXXXXX +40%   
**1 Year**: XXXXXX +24%   
**1-Year High**: XXXXX on 2025-06-27   
**1-Year Low**: XXX on 2024-08-28   
 
| Social Network | X     | Reddit | YouTube | TikTok |
| -------------- | -     | ------ | ------- | ------ |
| Mentions       | XXXXX | XX     | XX      | X      |
  
 
   
   
### Creators: XXX [#](/topic/gatetoken/contributors_active) 
--- 
XXX unique social accounts have posts mentioning GateToken (GT) in the last XX hours which is up XXXX% from XXX in the previous XX hours 
**Daily Average**: XXX   
**1 Week**: XXX +32%   
**1 Month**: XXXXX -XX%   
**6 Months**: XXXXX +17%   
**1 Year**: XXXXXX +22%   
**1-Year High**: XXX on 2025-01-25   
**1-Year Low**: XX on 2024-09-09   
 
The most influential creators that mention GateToken in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@CRYPTO_GLOBAL10](/creator/twitter/CRYPTO_GLOBAL10) | X    | XXXXX     | XXX   | XXXXXX      |
| [@Gate_io](/creator/twitter/Gate_io)                 | X    | XXXXXXXXX | X     | XXXXXX      |
| [@DyorNetCrypto](/creator/twitter/DyorNetCrypto)     | X    | XXXXXX    | XX    | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)       | X    | XXXXX     | XX    | XXXXX       |
| [@Oficial__odds](/creator/twitter/Oficial__odds)     | X    | XXX       | XX    | XXXXX       |
| [@bingerloud](/creator/twitter/bingerloud)           | X    | XXX       | XX    | XXXXX       |
| [@Gate_Launch](/creator/twitter/Gate_Launch)         | X    | XXXXXXX   | X     | XXXXX       |
| [@NYBBWAA](/creator/twitter/NYBBWAA)                 | X    | XXXXX     | X     | XXXXX       |
| [@_Dragnipur_](/creator/twitter/_Dragnipur_)         | X    | XXXXX     | X     | XXXXX       |
| [@ADVIK_SIGNALS](/creator/twitter/ADVIK_SIGNALS)     | XX   | XXX       | X     | XXX         |
 
[View More](/list/creators/gatetoken/100) 
   
   
### Sentiment: XX% [#](/topic/gatetoken/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +3%   
**1 Month**: XX% +2%   
**6 Months**: XX% +2%   
**1 Year**: XX% +23%   
**1-Year High**: XX% on 2025-02-20   
**1-Year Low**: XX% on 2024-07-30   
 
**Most Supportive Themes** 
- **Airdrops and Staking Incentives:** (40%) Users are actively participating in airdrops and launchpools, with Gate.io promoting these incentives, and social media is abuzz with discussion and promotion. 
- **Social Media Promotion and Discussion:** (40%) GateToken is actively promoted and discussed across social media platforms, especially X, with positive sentiments and significant engagement. 
- **New Listings and Opportunities:** (10%) New listings and staking opportunities on Gate.io are driving positive engagement and interest in GT, with users highlighting potential rewards. 
   
**Most Critical Themes** 
- **Negative Sentiment on X:** (1%)  Concerns and criticisms are being expressed on X regarding GateToken. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXX    | X% |
| Reddit  | X        | X%  | X       | X%  | X        | X% |
| YouTube | XX       | X%  | XXX     | X%  | XX       | X% |
| TikTok  | X        | X%  | X       | X%  | XXX      | X% |
|         |          |     |         |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXX    | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/gatetoken/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.032%   
**1 Month**: XXXXX% +0.092%   
**6 Months**: XXXXX% +0.108%   
**1 Year**: XXXXX% +0.158%   
**1-Year High**: XXXXX% on 2025-07-28   
**1-Year Low**: XXXXX% on 2024-11-14   
   
   
### Trading Volume: $XXXXXXXXXX [#](/topic/gatetoken/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXX   
**Daily Average**: $XXXXXXXXXX   
**1 Week**: $XXXXXXXXXX -$19%   
**1 Month**: $XXXXXXXXXX +$175%   
**6 Months**: $XXXXXXXXXX -$60%   
**1 Year**: $XXXXXXXXXX +$604%   
**1-Year High**: $XXXXXXXXXX on 2024-12-26   
**1-Year Low**: $XXXXXXX on 2024-08-31   
   
   
### Market Dominance: XXXXX% [#](/topic/gatetoken/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-04-09   
**1-Year Low**: XXXXX% on 2024-11-22   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/gatetoken/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$4%   
**1 Month**: $XXXXXXXXXXXXX +$18%   
**6 Months**: $XXXXXXXXXXXXX -$27%   
**1 Year**: $XXXXXXXXXXXXX +$123%   
**1-Year High**: $XXXXXXXXXXXXX on 2025-01-26   
**1-Year Low**: $XXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/gatetoken/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-29   
**1-Year Low**: XXXXXXXXXXX on 2025-07-06  

# Uniswap 
[Uniswap](/topic/$uni) 
Uniswap has been trending bullishly, with some analysts suggesting it could be a good investment. A proposal for Uniswap Labs to go public and use profits to buy UNI tokens has been circulating. Meanwhile, some users are comparing Uniswap to another platform, Base, which is gaining traction on Ethereum. 

### Price: $XXXXX [#](/topic/$uni/close) 
--- 
UNI is currently trading at $7.40, with recent gains across multiple timeframes. Increased trading volume and positive sentiment, along with strong social engagement and new integrations, suggest potential for further upward movement, despite trading near a resistance level.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| -XXX%  | -XXXX%  | -XXXX% | XXXX%  |
 
**1-Year High**: $XXXXX on 2024-12-08   
**1-Year Low**: $XXXX on 2025-04-08   
   
   
### AltRank: XXX [#](/topic/$uni/alt_rank) 
--- 
Uniswap (UNI) is currently AltRank #478 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +292   
**1 Month**: XXX +359   
**6 Months**: XXX +404   
**1 Year**: XXX +266   
**1-Year High**: XXXXX on 2025-02-04   
**1-Year Low**: X on 2025-06-10   
   
   
### Galaxy Score: XXXXX [#](/topic/$uni/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX -X   
**6 Months**: XX -X   
**1 Year**: XX +17   
**1-Year High**: XX on 2025-06-10   
**1-Year Low**: XX on 2024-11-01   
   
   
### Engagements: XXXXXXX [#](/topic/$uni/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX -XX%   
**1 Month**: XXXXXXXXXX +18%   
**6 Months**: XXXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXXX -XX%   
**1-Year High**: XXXXXXXXX on 2024-12-13   
**1-Year Low**: XXXXXXX on 2024-11-01   
 
| Social Network | X       | YouTube | Reddit | TikTok |
| -------------- | -       | ------- | ------ | ------ |
| Engagements    | XXXXXXX | XXX     | X      | X      |
  
 
   
   
### Mentions: XXXXX [#](/topic/$uni/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +5.90%   
**1 Month**: XXXXXX +47%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXX +19%   
**1-Year High**: XXXXX on 2025-07-22   
**1-Year Low**: XXX on 2025-04-19   
 
| Social Network | X     | YouTube | Reddit | TikTok |
| -------------- | -     | ------- | ------ | ------ |
| Mentions       | XXXXX | XX      | XX     | X      |
  
 
   
   
### Creators: XXXXX [#](/topic/$uni/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Uniswap (UNI) in the last XX hours which is up X% from XXXXX in the previous XX hours 
**Daily Average**: XXX   
**1 Week**: XXXXX +3%   
**1 Month**: XXXXX +3.20%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXX -XXXX%   
**1-Year High**: XXXXX on 2024-12-09   
**1-Year Low**: XXX on 2025-04-07   
 
The most influential creators that mention Uniswap in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@CRYPTO_GLOBAL10](/creator/twitter/CRYPTO_GLOBAL10) | X    | XXXXX     | XXX   | XXXXXX      |
| [@Simonwarick438](/creator/twitter/Simonwarick438)   | X    | XXX       | XXX   | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)       | X    | XXXXX     | XX    | XXXXXX      |
| [@Oficial__odds](/creator/twitter/Oficial__odds)     | X    | XXX       | XX    | XXXXXX      |
| [@bingerloud](/creator/twitter/bingerloud)           | X    | XXX       | XX    | XXXXXX      |
| [@CorX2025](/creator/twitter/CorX2025)               | X    | XXX       | XX    | XXXXXX      |
| [@digishahed](/creator/twitter/digishahed)           | X    | XXXXXX    | X     | XXXXXX      |
| [@DyorNetCrypto](/creator/twitter/DyorNetCrypto)     | X    | XXXXXX    | XX    | XXXXX       |
| [@Takundaa001](/creator/twitter/Takundaa001)         | X    | XXX       | X     | XXXXX       |
| [@Goodluck464992](/creator/twitter/Goodluck464992)   | XX   | XXX       | XX    | XXXXX       |
 
[View More](/list/creators/$uni/100) 
   
   
### Sentiment: XX% [#](/topic/$uni/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +7%   
**1 Month**: XX% -X%   
**6 Months**: XX% +1%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-10-20   
**1-Year Low**: XX% on 2025-04-08   
 
**Most Supportive Themes** 
- **Strong Fundamentals and Financial Stability:** (35%) Positive sentiment is driven by Uniswap's strong fundamentals, financial stability, and its security as a decentralized exchange. 
- **Whale Accumulation and Institutional Interest:** (30%) Significant whale activity involving UNI and institutional interest suggest strong confidence among large investors. 
- **Anticipation of Crypto Rally and Technical Breakout:** (20%) Potential catalysts for UNI's price growth include a crypto rally boosting ETH and SOL, and technical analysis showing a potential breakout. 
   
**Most Critical Themes** 
- **Legal Challenges and Bearish Sentiment:** (0.54%)  Concerns over legal challenges and disappointing price performance are intensifying bearish sentiment. 
- **Underperformance and Investor Disappointment:** (0.54%)  Disappointment with UNI's price performance compared to memecoins and concerns about early investors selling off. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXX    | X% |
| YouTube | XXX      | X%  | X       | X%  | X        | X% |
| Reddit  | X        | X%  | X       | X%  | X        | X% |
| TikTok  | X        | X%  | X       | X%  | X        | X% |
|         |          |     |         |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXX    | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/$uni/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.08%   
**1 Month**: XXXXX% +0.254%   
**6 Months**: XXXXX% +0.133%   
**1 Year**: XXXXX% +0.097%   
**1-Year High**: XXXXX% on 2024-08-24   
**1-Year Low**: XXXX% on 2025-04-22   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/$uni/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX -$48%   
**1 Month**: $XXXXXXXXXXX +$121%   
**6 Months**: $XXXXXXXXXXX -$21%   
**1 Year**: $XXXXXXXXXXX +$550%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-12-20   
**1-Year Low**: $XXXXXXXXXX on 2024-08-10   
   
   
### Market Dominance: XXXXX% [#](/topic/$uni/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2024-12-08   
**1-Year Low**: XXXXX% on 2025-05-07   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/$uni/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$3.10%   
**1 Month**: $XXXXXXXXXXXXX +$55%   
**6 Months**: $XXXXXXXXXXXXX -$6.30%   
**1 Year**: $XXXXXXXXXXXXX +$17%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-12-08   
**1-Year Low**: $XXXXXXXXXXXXX on 2025-04-08   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/$uni/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-29   
**1-Year Low**: XXXXXXXXXXX on 2024-10-28  

# Jupiter 
[Jupiter](/topic/$jup) 
Jupiter ($JUP) is facing a significant event with a $XX million token unlock scheduled for July XX. The token is currently testing support at $XXXX and has potential for growth, with some investors believing it could reach the top XX tokens by market cap. Additionally, the Jupiter ecosystem is gaining traction, with related tokens like $Uranus and $Milky Way seeing increased interest. 

### Price: $XXXXX [#](/topic/$jup/close) 
--- 
The price of JUP is currently trading at $0.459, up XXXX% in the last XX hours. Positive social sentiment and high trading volume suggest continued interest and potential for a rebound, despite some concerns about price manipulation.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| -XXXX% | -X%     | -XXXX% | XXXXX% |
 
**1-Year High**: $XXXXX on 2025-07-27   
**1-Year Low**: $XXXXXXXXXXXXXXXXXXXX on 2025-07-25   
   
   
### AltRank: XXXXX [#](/topic/$jup/alt_rank) 
--- 
Jupiter (JUP) is currently AltRank #1,067 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +663   
**1 Month**: XXX +665   
**6 Months**: XXX -XXX   
**1 Year**: XXX +667   
**1-Year High**: XXXXX on 2025-07-04   
**1-Year Low**: X on 2024-09-21   
   
   
### Galaxy Score: XXXXX [#](/topic/$jup/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX -XX   
**6 Months**: XX +16   
**1 Year**: XX +22   
**1-Year High**: XX on 2025-03-25   
**1-Year Low**: XX on 2025-05-29   
   
   
### Engagements: XXXXXXX [#](/topic/$jup/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX +18%   
**1 Month**: XXXXXXXXXX +31%   
**6 Months**: XXXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXXX -XX%   
**1-Year High**: XXXXXXXXX on 2025-01-22   
**1-Year Low**: XXXXXX on 2025-05-02   
 
| Social Network | X       | YouTube | Reddit | TikTok | News |
| -------------- | -       | ------- | ------ | ------ | ---- |
| Engagements    | XXXXXXX | XXXXX   | XX     | XXX    | X    |
  
 
   
   
### Mentions: XXXXX [#](/topic/$jup/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXX +12%   
**1 Month**: XXXXXX +23%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXX on 2025-01-23   
**1-Year Low**: XXX on 2024-09-16   
 
| Social Network | X     | YouTube | Reddit | TikTok | News |
| -------------- | -     | ------- | ------ | ------ | ---- |
| Mentions       | XXXXX | XX      | XX     | X      | X    |
  
 
   
   
### Creators: XXXXX [#](/topic/$jup/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Jupiter (JUP) in the last XX hours which is up X% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +45%   
**1 Month**: XXXXX +9.60%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXX -XX%   
**1-Year High**: XXXXX on 2025-01-22   
**1-Year Low**: XXX on 2024-09-16   
 
The most influential creators that mention Jupiter in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@lochiejarvis201](/creator/twitter/lochiejarvis201) | X    | XXXXXX    | X     | XXXXXX      |
| [@FamousCloudzz](/creator/twitter/FamousCloudzz)     | X    | XXXXXX    | X     | XXXXXX      |
| [@sanamcute1990](/creator/twitter/sanamcute1990)     | X    | XX        | XX    | XXXXXX      |
| [@MikeTheGambler_](/creator/twitter/MikeTheGambler_) | X    | XXXXX     | X     | XXXXXX      |
| [@weremeow](/creator/twitter/weremeow)               | X    | XXXXXXX   | X     | XXXXX       |
| [@CryptoBull31](/creator/twitter/CryptoBull31)       | X    | XXXXXX    | X     | XXXXX       |
| [@CorX2025](/creator/twitter/CorX2025)               | X    | XXX       | XX    | XXXXX       |
| [@JSinsCrypto](/creator/twitter/JSinsCrypto)         | X    | XXXXXX    | X     | XXXXX       |
| [@watchingmarkets](/creator/twitter/watchingmarkets) | X    | XXXXXX    | X     | XXXXX       |
| [@whalewatchalert](/creator/twitter/whalewatchalert) | XX   | XXXXXXX   | X     | XXXXX       |
 
[View More](/list/creators/$jup/100) 
   
   
### Sentiment: XX% [#](/topic/$jup/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +1%   
**1 Month**: XX% -X%   
**6 Months**: XX% no change   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2025-06-29   
**1-Year Low**: XX% on 2025-03-09   
 
**Most Supportive Themes** 
- **Bullish sentiment and accumulation:** (10%) Posts express bullish sentiment towards $JUP, noting its strength in the market, potential for breakouts, and ongoing accumulation. 
- **Jupiter's strong ecosystem and product development:** (6%) Posts highlight Jupiter's strong ecosystem, product development, and its position as a leading DEX aggregator on Solana. 
- **Partnership with Huma Finance:** (2%) The partnership between Jupiter and Huma Finance is viewed positively. 
   
**Most Critical Themes** 
- **Price manipulation and potential for losses:** (0.03%)  Concerns over price manipulation and potential for losses were expressed in a small number of posts. 
- **Concerns about Huma Finance:** (0.03%)  A small number of posts expressed concerns about Huma Finance allocations and vesting periods, as well as general negative sentiment. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXX   | X% |
| YouTube | XXX      | X%  | XXXXX   | X%  | X        | X% |
| Reddit  | X        | X%  | X       | X%  | X        | X% |
| TikTok  | XX       | X%  | XXX     | X%  | X        | X% |
| News    | X        | X%  | X       | X%  | X        | X% |
|         |          |     |         |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXX   | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/$jup/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.121%   
**1 Month**: XXXXX% +0.071%   
**6 Months**: XXXXX% -XXXXX%   
**1 Year**: XXXXX% -XXXXX%   
**1-Year High**: XXXXX% on 2025-01-27   
**1-Year Low**: XXXXX% on 2025-07-12   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/$jup/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX -$16%   
**1 Month**: $XXXXXXXXXXX +$141%   
**6 Months**: $XXXXXXXXXXX -$73%   
**1 Year**: $XXXXXXXXXXX +$10%   
**1-Year High**: $XXXXXXXXXXXXX on 2025-01-27   
**1-Year Low**: $XXXXXXXX on 2025-02-14   
   
   
### Market Dominance: XXXXX% [#](/topic/$jup/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-07-27   
**1-Year Low**: XXXXXXX% on 2025-01-18   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/$jup/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$150,885%   
**1 Month**: $XXXXXXXXXXXXX +$169,320%   
**6 Months**: $XXXXXXXXXXXXX +$208,785%   
**1 Year**: $XXXXXXXXXXXXX +$245,170%   
**1-Year High**: $XXXXXXXXXXXXX on 2025-07-27   
**1-Year Low**: $XXXXXXXXX on 2025-07-25   
   
   
### Circulating Supply: XXXXXXXXXXXXX [#](/topic/$jup/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXX on 2025-07-01   
**1-Year Low**: XXXXXXXXXXXXX on 2024-07-29

[Exchange Tokens](/topic/coins-exchange-tokens) 
BNB rockets to new all-time highs, with bulls running wild.  Binance Coin price targets $XXX as Maxwell Hard Fork Boosts On-Chain Activity. 

Creators: XXXXXX 
XXXXXX unique social accounts have posts mentioning Exchange Tokens in the last XX hours which is down XXXX% from XXXXXX in the previous XX hours 
**Daily Average**: XXXXXX   
**1 Week**: XXXXXX -X%   
**1 Month**: XXXXXX +30%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2025-04-08   
 
The most influential creators that mention Exchange Tokens in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@HoudiniSwap](/creator/twitter/HoudiniSwap)         | X    | XXXXXX    | XX    | XXXXXXXXX   |
| [@MEXC_Listings](/creator/twitter/MEXC_Listings)     | X    | XXXXXXX   | X     | XXXXXXX     |
| [@cronostop](/creator/youtube/cronostop)             | X    | XXXXXX    | X     | XXXXXXX     |
| [@CronosNewDawn](/creator/twitter/CronosNewDawn)     | X    | XXXXX     | X     | XXXXXXX     |
| [@CredibleCrypto](/creator/twitter/CredibleCrypto)   | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@BNBCHAIN](/creator/twitter/BNBCHAIN)               | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@eWhispers](/creator/twitter/eWhispers)             | X    | XXXXXXX   | X     | XXXXXXX     |
| [@redlinegamingz](/creator/youtube/redlinegamingz)   | X    | XXXXXX    | X     | XXXXXXX     |
| [@AltcoinDaily](/creator/twitter/AltcoinDaily)       | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@RaydiumProtocol](/creator/twitter/RaydiumProtocol) | XX   | XXXXXXX   | XX    | XXXXXXX     |
 
[View More](/list/creators/coins-exchange-tokens/100) 
   
   
Sentiment: XX% 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-09-16   
**1-Year Low**: XX% on 2025-01-31   
 
**Most Supportive Themes** 
- **Exchange Listings & Partnerships:** (46%) Exchange listings and partnerships are driving increased liquidity and volume, with platforms building infrastructure for tokenizing assets. 
- **Community Building & Staking Rewards:** (46%) Projects with strong community support, staking rewards, and governance participation see increased engagement. 
- **Tokenization of Real-World Assets:** (46%) Platforms are building infrastructure for tokenizing assets like real estate. 
   
**Most Critical Themes** 
- **Rug Pulls and Scams and Regulatory Risks:** (7%)  Concerns around rug pulls, scams, and regulatory risks are present in the discussion. 
   
Network engagement breakdown:   
| Network | Positive  | %   | Neutral   | %   | Negative  | %  |
| ------- | --------  | -   | -------   | -   | --------  | -  |
| X       | XXXXXXXXX | XX% | XXXXXXXXX | XX% | XXXXXXX   | X% |
| Reddit  | XXXXX     | X%  | XXX       | X%  | XX        | X% |
| YouTube | XXXXXXX   | X%  | XXXXXXX   | X%  | XXXXXXX   | X% |
| TikTok  | XXXXXXX   | X%  | XXXXXXX   | X%  | XXXXXX    | X% |
| News    | XXXXX     | X%  | XX        | X%  | X         | X% |
|         |           |     |           |     |           |    |
| Total   | XXXXXXXXX | XX% | XXXXXXXXX | XX% | XXXXXXXXX | X% |

[Cryptocurrencies](/topic/_cryptocurrencies) 
Major financial institutions and billionaires, such as Ray Dalio, are increasingly recommending or investing in cryptocurrencies, with Dalio suggesting a 1-15% allocation to Bitcoin and gold. Ethereum is gaining momentum, with a record $XXXX billion in inflows in July and some analysts predicting a significant price increase. Additionally, PayPal has enabled Bitcoin and crypto payments for US merchants, marking a significant step towards mainstream adoption. 

Creators: XXXXXXX 
XXXXXXX unique social accounts have posts mentioning Cryptocurrencies in the last XX hours which is up X% from XXXXXXX in the previous XX hours 
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXX -XXXX%   
**1 Month**: XXXXXXXXX +12%   
**6 Months**: XXXXXXXXX -XX%   
**1 Year**: XXXXXXXXX +13%   
**1-Year High**: XXXXXXX on 2024-11-26   
**1-Year Low**: XXXXXXX on 2024-08-11   
 
The most influential creators that mention Cryptocurrencies in the last XX hours 
 
| Creator                                          | Rank | Followers | Posts | Engagements |
| -------                                          | ---- | --------- | ----- | ----------- |
| [@DiceElDani](/creator/twitter/DiceElDani)       | X    | XXXXX     | XX    | XXXXXXXXX   |
| [@eToro](/creator/twitter/eToro)                 | X    | XXXXXXX   | X     | XXXXXXXXX   |
| [@rovercrc](/creator/twitter/rovercrc)           | X    | XXXXXXXXX | XXX   | XXXXXXXXX   |
| [@anatoxich](/creator/youtube/anatoxich)         | X    | XXXXXXXXX | X     | XXXXXXXXX   |
| [@MEXC_Listings](/creator/twitter/MEXC_Listings) | X    | XXXXXXX   | XX    | XXXXXXXXX   |
| [@Cointelegraph](/creator/twitter/Cointelegraph) | X    | XXXXXXXXX | XXX   | XXXXXXXXX   |
| [@MEXC_Official](/creator/twitter/MEXC_Official) | X    | XXXXXXXXX | XX    | XXXXXXXXX   |
| [@cryptocom](/creator/twitter/cryptocom)         | X    | XXXXXXXXX | XX    | XXXXXXXXX   |
| [@MMCrypto](/creator/twitter/MMCrypto)           | X    | XXXXXXXXX | XX    | XXXXXXXXX   |
| [@yeti_memecoin](/creator/youtube/yeti_memecoin) | XX   | XXXXXX    | XX    | XXXXXXXXX   |
 
[View More](/list/creators/_cryptocurrencies/100) 
   
   
Sentiment: XX% 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% no change   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-08-20   
**1-Year Low**: XX% on 2025-03-19   
 
**Most Supportive Themes** 
- **Bitcoin's Bullish Momentum and Altcoin Developments:** (43%) Bitcoin's positive price movement and the adoption by institutional entities are driving positive sentiment in the market. Technological advancements, partnerships, and exchange listings of altcoins are all contributing to positive sentiment within the crypto community. 
   
**Most Critical Themes** 
- **Centralization and Regulatory Concerns and Security Risks and Illicit Activities:** (15%)  Concerns regarding centralization, regulatory issues, security risks, and illicit activities within the crypto space are being discussed. 
   
Network engagement breakdown:   
| Network | Positive    | %   | Neutral     | %   | Negative   | %   |
| ------- | --------    | -   | -------     | -   | --------   | -   |
| X       | XXXXXXXXXXX | XX% | XXXXXXXXXXX | XX% | XXXXXXXXXX | X%  |
| YouTube | XXXXXXXXXX  | X%  | XXXXXXXXXX  | X%  | XXXXXXXXX  | X%  |
| Reddit  | XXXXXX      | X%  | XXXXXXX     | X%  | XXXXXX     | X%  |
| News    | XXXXXXX     | X%  | XXXXXXX     | X%  | XXXXXXX    | X%  |
| TikTok  | XXXXXXXXX   | X%  | XXXXXXXXXX  | X%  | XXXXXXXXX  | X%  |
|         |             |     |             |     |            |     |
| Total   | XXXXXXXXXXX | XX% | XXXXXXXXXXX | XX% | XXXXXXXXXX | XX% |