[GUEST ACCESS MODE: Data is scrambled or limited to provide examples. Make requests using your API key to unlock full data. Check https://lunarcrush.ai/auth for authentication information.]

Top XX Cryptocurrencies in Layer X by Market Cap

| Coin                                      | Market Cap         |
| ----                                      | ----------         |
| [Bitcoin (BTC)](/topic/bitcoin)           | $XXXXXXXXXXXXXXXXX |
| [Ethereum (ETH)](/topic/ethereum)         | $XXXXXXXXXXXXXXX   |
| [BNB (BNB)](/topic/binance-coin)          | $XXXXXXXXXXXXXXX   |
| [Solana (SOL)](/topic/solana)             | $XXXXXXXXXXXXXX    |
| [TRON (TRX)](/topic/$trx)                 | $XXXXXXXXXXXXXX    |
| [Cardano (ADA)](/topic/cardano)           | $XXXXXXXXXXXXXX    |
| [Hyperliquid (HYPE)](/topic/$hype)        | $XXXXXXXXXXXXXX    |
| [Sui (SUI)](/topic/$sui)                  | $XXXXXXXXXXXXXX    |
| [Hedera (HBAR)](/topic/$hbar)             | $XXXXXXXXXXXXXX    |
| [Bitcoin Cash (BCH)](/topic/bitcoin-cash) | $XXXXXXXXXXXXX     |


# Bitcoin 
[Bitcoin](/topic/bitcoin) 
Regulatory developments are currently a major focus in the Bitcoin space. The US House has passed a procedural vote on crypto-related bills, including the "Genius and Clarity Acts", and the SEC has delayed its decision on Bitwise's proposal for in-kind redemptions for Bitcoin and Ethereum ETFs. Additionally, lawmakers in France are exploring the possibility of generating revenue from Bitcoin mining. 

### Price: $XXXXXXXXXX [#](/topic/bitcoin/close) 
--- 
Bitcoin is experiencing a strong bullish trend, hitting an all-time high, driven by institutional adoption, strong inflows into Bitcoin ETFs, and the perception of Bitcoin as a hedge against economic uncertainties. The price has increased XXX% in the last XX hours, with a current price of $120,153.80, and a 1-Year High of $XXXXXXXXXX on 2025-07-14.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| XXXX%  | XXXX%   | XXXX% | XXXXX% |
 
**1-Year High**: $XXXXXXXXXX on 2025-07-14   
**1-Year Low**: $XXXXXX on 2024-09-06   
   
   
### AltRank: XXX [#](/topic/bitcoin/alt_rank) 
--- 
Bitcoin (BTC) is currently AltRank #690 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +659   
**1 Month**: XXX +835   
**6 Months**: XXX +988   
**1 Year**: XXX +953   
**1-Year High**: XXXXX on 2025-06-30   
**1-Year Low**: X on 2024-08-08   
   
   
### Galaxy Score: XXXXX [#](/topic/bitcoin/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -X   
**1 Month**: XX -X   
**6 Months**: XX -X   
**1 Year**: XX +22   
**1-Year High**: XX on 2024-11-06   
**1-Year Low**: XX on 2025-07-12   
   
   
### Engagements: XXXXXXXXXXX [#](/topic/bitcoin/interactions) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1 Week**: XXXXXXXXXXXXX +42%   
**1 Month**: XXXXXXXXXXXXX +2.50%   
**6 Months**: XXXXXXXXXXXXXX -XXXX%   
**1 Year**: XXXXXXXXXXXXXX -XXXX%   
**1-Year High**: XXXXXXXXXXX on 2024-12-05   
**1-Year Low**: XXXXXXXXXX on 2025-07-17   
 
| Social Network | X           | Reddit  | News    | YouTube    | TikTok    |
| -------------- | -           | ------  | ----    | -------    | ------    |
| Engagements    | XXXXXXXXXXX | XXXXXXX | XXXXXXX | XXXXXXXXXX | XXXXXXXXX |
  
 
   
   
### Mentions: XXXXXXX [#](/topic/bitcoin/posts_active) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXX +11%   
**1 Month**: XXXXXXXXX +77%   
**6 Months**: XXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXX +26%   
**1-Year High**: XXXXXXX on 2024-11-26   
**1-Year Low**: XXXXXX on 2024-08-11   
 
| Social Network | X       | Reddit | News  | YouTube | TikTok |
| -------------- | -       | ------ | ----  | ------- | ------ |
| Mentions       | XXXXXXX | XXXXXX | XXXXX | XXXXXX  | XXXXXX |
  
 
   
   
### Creators: XXXXXX [#](/topic/bitcoin/contributors_active) 
--- 
XXXXXX unique social accounts have posts mentioning Bitcoin (BTC) in the last XX hours which is down XXXX% from XXXXXX in the previous XX hours 
**Daily Average**: XXXXXX   
**1 Week**: XXXXXXX +14%   
**1 Month**: XXXXXXX +55%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXXXX +26%   
**1-Year High**: XXXXXXX on 2024-12-05   
**1-Year Low**: XXXXXX on 2024-08-11   
 
The most influential creators that mention Bitcoin in the last XX hours 
 
| Creator                                              | Rank | Followers   | Posts | Engagements |
| -------                                              | ---- | ---------   | ----- | ----------- |
| [@elonmusk](/creator/twitter/elonmusk)               | X    | XXXXXXXXXXX | X     | XXXXXXXXX   |
| [@BitcoinMagazine](/creator/twitter/BitcoinMagazine) | X    | XXXXXXXXX   | XXX   | XXXXXXXXX   |
| [@Vivek4real_](/creator/twitter/Vivek4real_)         | X    | XXXXXXX     | XX    | XXXXXXXXX   |
| [@AlexesNakamoto](/creator/twitter/AlexesNakamoto)   | X    | XXXXX       | X     | XXXXXXXXX   |
| [@BTC_Archive](/creator/twitter/BTC_Archive)         | X    | XXXXXXXXX   | XX    | XXXXXXXXX   |
| [@eToro](/creator/twitter/eToro)                     | X    | XXXXXXX     | X     | XXXXXXXXX   |
| [@Cobratate](/creator/twitter/Cobratate)             | X    | XXXXXXXXXX  | X     | XXXXXXXXX   |
| [@rovercrc](/creator/twitter/rovercrc)               | X    | XXXXXXXXX   | XXX   | XXXXXXXXX   |
| [@SenLummis](/creator/twitter/SenLummis)             | X    | XXXXXXX     | X     | XXXXXXXXX   |
| [@BitcoinNewsCom](/creator/twitter/BitcoinNewsCom)   | XX   | XXXXXXX     | XX    | XXXXXXXXX   |
 
[View More](/list/creators/bitcoin/100) 
   
   
### Sentiment: XX% [#](/topic/bitcoin/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +1%   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% +3%   
**1-Year High**: XX% on 2024-11-07   
**1-Year Low**: XX% on 2024-08-05   
 
**Most Supportive Themes** 
- **Institutional Adoption and Strategic Accumulation:** (42%) There was an emphasis on the increasing adoption of Bitcoin by institutional investors and corporations, viewing it as a long-term store of value. 
- **Bitcoin as a Hedge Against Economic Uncertainty:** (35%) Posts supported Bitcoin's role as a hedge against economic uncertainties, fiat currency debasement, and government control. 
- **Innovation and Development in Bitcoin Ecosystem:** (15%) Discussion of the ongoing innovation and development within the Bitcoin ecosystem, including layer-2 solutions and DeFi applications. 
   
**Most Critical Themes** 
- **Concerns Over Centralization and Limited Functionality:** (8%)  Concerns were raised over centralization and limited functionality within the Bitcoin ecosystem. 
   
Network engagement breakdown:   
| Network | Positive   | %   | Neutral    | %   | Negative   | %   |
| ------- | --------   | -   | -------    | -   | --------   | -   |
| X       | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% | XXXXXXXXXX | X%  |
| Reddit  | XXXXXX     | X%  | XXXXXXX    | X%  | XXXXXX     | X%  |
| News    | XXXXXXX    | X%  | XXXXXXX    | X%  | XXXXXX     | X%  |
| YouTube | XXXXXXXXX  | X%  | XXXXXXXXX  | X%  | XXXXXXXXX  | X%  |
| TikTok  | XXXXXXXXX  | X%  | XXXXXXXXX  | X%  | XXXXXXX    | X%  |
|         |            |     |            |     |            |     |
| Total   | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/bitcoin/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +2.70%   
**1 Month**: XXXXX% +9.70%   
**6 Months**: XXXXX% +10%   
**1 Year**: XXXXX% +8.60%   
**1-Year High**: XXXXX% on 2025-07-16   
**1-Year Low**: XXXXX% on 2025-01-05   
   
   
### Trading Volume: $XXXXXXXXXXXXXX [#](/topic/bitcoin/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$21%   
**1 Month**: $XXXXXXXXXXXXXX +$45%   
**6 Months**: $XXXXXXXXXXXXXX -$1%   
**1 Year**: $XXXXXXXXXXXXXX +$75%   
**1-Year High**: $XXXXXXXXXXXXXXX on 2024-12-05   
**1-Year Low**: $XXXXXXXXXXXXX on 2025-03-22   
   
   
### Market Dominance: XXXXX% [#](/topic/bitcoin/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XX%   
**1-Year High**: XXXXX% on 2025-05-08   
**1-Year Low**: XXXXX% on 2024-12-09   
   
   
### Market Cap: $XXXXXXXXXXXXXXXXX [#](/topic/bitcoin/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXXXXX +$6.20%   
**1 Month**: $XXXXXXXXXXXXXXXXX +$11%   
**6 Months**: $XXXXXXXXXXXXXXXXX +$13%   
**1 Year**: $XXXXXXXXXXXXXXXXX +$83%   
**1-Year High**: $XXXXXXXXXXXXXXXXX on 2025-07-14   
**1-Year Low**: $XXXXXXXXXXXXXXXXX on 2024-09-06   
   
   
### Circulating Supply: XXXXXXXXXX [#](/topic/bitcoin/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXX   
**Daily Average**: XXXXXXXXXX   
**1-Year High**: XXXXXXXXXX on 2025-07-17   
**1-Year Low**: XXXXXXXXXX on 2024-07-18  

# Solana 
[Solana](/topic/solana) 
Solana has seen significant growth in blockchain transactions, reaching XXX million in just X days. The ecosystem is also expanding with new products and partnerships, such as ProShares launching leveraged Solana and XRP ETFs, and Bit Mining Limited pivoting to Solana with a $300m raise. Additionally, Pump.fun, a Solana-based memecoin platform, has made headlines with a successful ICO and a token market cap exceeding $X billion. 

### Price: $XXXXXX [#](/topic/solana/close) 
--- 
Solana's price is experiencing a slight dip due to broader market corrections and network congestion concerns, but social posts suggest potential for recovery with positive sentiment and anticipation of ETF approvals and increased trading volume.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| XXXX%  | XXX%    | XXXX% | XXXXX% |
 
**1-Year High**: $XXXXXX on 2025-01-22   
**1-Year Low**: $XXXXXX on 2025-04-08   
   
   
### AltRank: XXX [#](/topic/solana/alt_rank) 
--- 
Solana (SOL) is currently AltRank #129 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XX -XXX   
**1 Month**: XXX -XXX   
**6 Months**: XXX -XXX   
**1 Year**: XXX +59   
**1-Year High**: XXXXX on 2025-06-21   
**1-Year Low**: X on 2024-08-07   
   
   
### Galaxy Score: XXXXX [#](/topic/solana/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX +14   
**6 Months**: XX -XX   
**1 Year**: XX -X   
**1-Year High**: XX on 2025-03-25   
**1-Year Low**: XX on 2025-05-23   
   
   
### Engagements: XXXXXXXXXX [#](/topic/solana/interactions) 
--- 
**Current Value**: XXXXXXXXXX   
**Daily Average**: XXXXXXXXXX   
**1 Week**: XXXXXXXXXXX +19%   
**1 Month**: XXXXXXXXXXXXX -XX%   
**6 Months**: XXXXXXXXXXXXX +5.40%   
**1 Year**: XXXXXXXXXXXXXX +40%   
**1-Year High**: XXXXXXXXXXX on 2025-01-19   
**1-Year Low**: XXXXXXXXX on 2025-07-17   
 
| Social Network | X          | YouTube   | TikTok    | Reddit | News   |
| -------------- | -          | -------   | ------    | ------ | ----   |
| Engagements    | XXXXXXXXXX | XXXXXXXXX | XXXXXXXXX | XXXXX  | XXXXXX |
  
 
   
   
### Mentions: XXXXXXX [#](/topic/solana/posts_active) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXX   
**1 Week**: XXXXXXX -XXXX%   
**1 Month**: XXXXXXX +53%   
**6 Months**: XXXXXXXXX -XX%   
**1 Year**: XXXXXXXXX +81%   
**1-Year High**: XXXXXXX on 2025-01-19   
**1-Year Low**: XXXXXX on 2024-10-05   
 
| Social Network | X       | YouTube | TikTok | Reddit | News |
| -------------- | -       | ------- | ------ | ------ | ---- |
| Mentions       | XXXXXXX | XXXXX   | XXXXX  | XXXXX  | XXX  |
  
 
   
   
### Creators: XXXXXX [#](/topic/solana/contributors_active) 
--- 
XXXXXX unique social accounts have posts mentioning Solana (SOL) in the last XX hours which is down XXXX% from XXXXXX in the previous XX hours 
**Daily Average**: XXXXXX   
**1 Week**: XXXXXX -XXXX%   
**1 Month**: XXXXXXX +52%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXXXX +65%   
**1-Year High**: XXXXXX on 2025-01-25   
**1-Year Low**: XXXXXX on 2024-10-06   
 
The most influential creators that mention Solana in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@yeti.solana](/creator/tiktok/yeti.solana)          | X    | XXXXXX    | XX    | XXXXXXXXX   |
| [@solana](/creator/twitter/solana)                   | X    | XXXXXXXXX | XX    | XXXXXXX     |
| [@yeti_memecoin](/creator/youtube/yeti_memecoin)     | X    | XXXXXX    | XX    | XXXXXXX     |
| [@MEXC_Official](/creator/twitter/MEXC_Official)     | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@micsolana](/creator/twitter/micsolana)             | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@MarinadeFinance](/creator/twitter/MarinadeFinance) | X    | XXXXXX    | XX    | XXXXXXX     |
| [@SolamaSPL](/creator/twitter/SolamaSPL)             | X    | XXXXXX    | X     | XXXXXXX     |
| [@chartup_io](/creator/twitter/chartup_io)           | X    | XXXXX     | X     | XXXXXXX     |
| [@solanight_](/creator/tiktok/solanight_)            | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@jeevanzhiyisong](/creator/tiktok/jeevanzhiyisong)  | XX   | XXXXXXX   | XX    | XXXXXXX     |
 
[View More](/list/creators/solana/100) 
   
   
### Sentiment: XX% [#](/topic/solana/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% +4%   
**1-Year High**: XX% on 2024-09-29   
**1-Year Low**: XX% on 2025-02-17   
 
**Most Supportive Themes** 
- **Ecosystem Expansion and Network Improvements, Growing DeFi and Memecoin Activity:** (54%) The Solana ecosystem's expansion due to key integrations and new projects, leading to increased engagement, and DeFi and memecoin activity are surging. 
   
**Most Critical Themes** 
- **Network and Scam Concerns, SEC Regulatory Scrutiny:** (7%)  Concerns about network congestion, potential scams, and delayed SEC decisions create uncertainty. 
   
Network engagement breakdown:   
| Network | Positive   | %   | Neutral    | %   | Negative  | %  |
| ------- | --------   | -   | -------    | -   | --------  | -  |
| X       | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% | XXXXXXXXX | X% |
| YouTube | XXXXXXX    | X%  | XXXXXXXXX  | X%  | XXXXXXX   | X% |
| TikTok  | XXXXXXX    | X%  | XXXXXXXXX  | XX% | XXXXXXX   | X% |
| Reddit  | XXXXX      | X%  | XXXXX      | X%  | XXXXX     | X% |
| News    | XXXXXX     | X%  | XXXXX      | X%  | XXXXX     | X% |
|         |            |     |            |     |           |    |
| Total   | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% | XXXXXXXXX | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/solana/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXX%   
**1 Week**: XXXXX% +3.80%   
**1 Month**: XXXXX% +18.40%   
**6 Months**: XXXXX% +18.10%   
**1 Year**: XXXXX% +20.30%   
**1-Year High**: XXXXX% on 2025-07-17   
**1-Year Low**: X% on 2024-10-19   
   
   
### Trading Volume: $XXXXXXXXXXXXX [#](/topic/solana/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$91%   
**1 Month**: $XXXXXXXXXXXXX +$94%   
**6 Months**: $XXXXXXXXXXXXX +$50%   
**1 Year**: $XXXXXXXXXXXXX +$196%   
**1-Year High**: $XXXXXXXXXXXXXX on 2025-01-19   
**1-Year Low**: $XXXXXXXXXXX on 2024-08-31   
   
   
### Market Dominance: XXXX% [#](/topic/solana/market_dominance) 
--- 
**Current Value**: XXXX%   
**Daily Average**: X%   
**1-Year High**: XXXX% on 2024-11-21   
**1-Year Low**: X% on 2025-04-06   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/solana/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$10%   
**1 Month**: $XXXXXXXXXXXXXX +$16%   
**6 Months**: $XXXXXXXXXXXXXX -$13%   
**1 Year**: $XXXXXXXXXXXXXX +$24%   
**1-Year High**: $XXXXXXXXXXXXXXX on 2025-01-22   
**1-Year Low**: $XXXXXXXXXXXXXX on 2025-04-08   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/solana/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2025-07-17   
**1-Year Low**: XXXXXXXXXXX on 2024-07-19  

# Ethereum 
[Ethereum](/topic/ethereum) 
Ethereum is seeing significant investment and adoption, with large inflows into Ethereum ETFs, including a record $XXXXX million on July XX. Major investors, such as BlackRock and Peter Thiel, are also buying into Ethereum, with BlackRock purchasing $XXXXX million worth of ETH. Additionally, companies like Sharplink Gaming are accumulating large amounts of ETH, with its treasury now holding over XXXXXXX ETH worth $XXXX billion. 

### Price: $XXXXX [#](/topic/ethereum/close) 
--- 
Ethereum's price is experiencing bullish momentum due to increased institutional investment and positive developments within the ecosystem, with the current price at $XXXXXXXX and a 1-hour change of 0.35%, further supported by increased trading volume and positive sentiment in social posts.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| XXXX%  | XXXX%   | XXXXX% | XXXXX% |
 
**1-Year High**: $XXXXXXXX on 2024-12-06   
**1-Year Low**: $XXXXX on 2025-04-08   
   
   
### AltRank: XX [#](/topic/ethereum/alt_rank) 
--- 
Ethereum (ETH) is currently AltRank #43 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XX -XX   
**1 Month**: XX -XXX   
**6 Months**: XX -XXX   
**1 Year**: XX -XXX   
**1-Year High**: XXXXX on 2025-06-21   
**1-Year Low**: X on 2024-11-27   
   
   
### Galaxy Score: XXXXX [#](/topic/ethereum/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -X   
**1 Month**: XX -X   
**6 Months**: XX -X   
**1 Year**: XX +4   
**1-Year High**: XX on 2025-05-08   
**1-Year Low**: XX on 2025-03-12   
   
   
### Engagements: XXXXXXXXXX [#](/topic/ethereum/interactions) 
--- 
**Current Value**: XXXXXXXXXX   
**Daily Average**: XXXXXXXXXX   
**1 Week**: XXXXXXXXXXX +31%   
**1 Month**: XXXXXXXXXXXXX +5%   
**6 Months**: XXXXXXXXXXXXX +16%   
**1 Year**: XXXXXXXXXXXXXX -X%   
**1-Year High**: XXXXXXXXXXX on 2024-12-13   
**1-Year Low**: XXXXXXXXXX on 2025-07-17   
 
| Social Network | X          | YouTube   | TikTok    | Reddit | News    |
| -------------- | -          | -------   | ------    | ------ | ----    |
| Engagements    | XXXXXXXXXX | XXXXXXXXX | XXXXXXXXX | XXXXXX | XXXXXXX |
  
 
   
   
### Mentions: XXXXXXX [#](/topic/ethereum/posts_active) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXX   
**1 Week**: XXXXXXX +12%   
**1 Month**: XXXXXXXXX +69%   
**6 Months**: XXXXXXXXX -XX%   
**1 Year**: XXXXXXXXX +14%   
**1-Year High**: XXXXXXX on 2025-01-20   
**1-Year Low**: XXXXXX on 2024-10-06   
 
| Social Network | X       | YouTube | TikTok | Reddit | News |
| -------------- | -       | ------- | ------ | ------ | ---- |
| Mentions       | XXXXXXX | XXXXXX  | XXXXX  | XXXXX  | XXX  |
  
 
   
   
### Creators: XXXXXX [#](/topic/ethereum/contributors_active) 
--- 
XXXXXX unique social accounts have posts mentioning Ethereum (ETH) in the last XX hours which is up XXXX% from XXXXXX in the previous XX hours 
**Daily Average**: XXXXXX   
**1 Week**: XXXXXXX +10%   
**1 Month**: XXXXXXX +54%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXXXX -XXXX%   
**1-Year High**: XXXXXX on 2025-01-20   
**1-Year Low**: XXXXXX on 2024-10-06   
 
The most influential creators that mention Ethereum in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@rovercrc](/creator/twitter/rovercrc)               | X    | XXXXXXXXX | XX    | XXXXXXXXX   |
| [@WatcherGuru](/creator/twitter/WatcherGuru)         | X    | XXXXXXXXX | XX    | XXXXXXXXX   |
| [@Ashcryptoreal](/creator/twitter/Ashcryptoreal)     | X    | XXXXXXXXX | XX    | XXXXXXXXX   |
| [@cryptocom](/creator/twitter/cryptocom)             | X    | XXXXXXXXX | X     | XXXXXXXXX   |
| [@intocryptoverse](/creator/twitter/intocryptoverse) | X    | XXXXXXXXX | X     | XXXXXXX     |
| [@IncomeSharks](/creator/twitter/IncomeSharks)       | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@lookonchain](/creator/twitter/lookonchain)         | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@WhaleInsider](/creator/twitter/WhaleInsider)       | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@CryptoGodJohn](/creator/twitter/CryptoGodJohn)     | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@Cointelegraph](/creator/twitter/Cointelegraph)     | XX   | XXXXXXXXX | XX    | XXXXXXX     |
 
[View More](/list/creators/ethereum/100) 
   
   
### Sentiment: XX% [#](/topic/ethereum/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% no change   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-11-06   
**1-Year Low**: XX% on 2024-12-13   
 
**Most Supportive Themes** 
- **Technological Advancements and Ecosystem Growth & DeFi Innovation and Adoption:** (45%) Posts are highlighting Ethereum's upgrades, institutional interest, and new features, which support further adoption and increased institutional interest and adoption in decentralized finance (DeFi). 
   
**Most Critical Themes** 
- **Concerns over Centralization, Scalability, and Performance Issues:** (8%)  Concerns regarding centralization, scalability, and performance issues, especially high transaction fees. 
   
Network engagement breakdown:   
| Network | Positive   | %   | Neutral    | %   | Negative  | %   |
| ------- | --------   | -   | -------    | -   | --------  | -   |
| X       | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% | XXXXXXXXX | X%  |
| YouTube | XXXXXXXXX  | X%  | XXXXXXXXX  | X%  | XXXXXXX   | X%  |
| TikTok  | XXXXXXX    | X%  | XXXXXXXXX  | X%  | XXXXXXX   | X%  |
| Reddit  | XXXXXX     | X%  | XXXXXX     | X%  | XXXXX     | X%  |
| News    | XXXXXXX    | X%  | XXXXXX     | X%  | XXXXXX    | X%  |
|         |            |     |            |     |           |     |
| Total   | XXXXXXXXXX | XX% | XXXXXXXXXX | XX% | XXXXXXXXX | XX% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/ethereum/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXX%   
**1 Week**: XXXXX% +11.20%   
**1 Month**: XXXXX% +26.70%   
**6 Months**: XXXXX% +28.50%   
**1 Year**: XXXXX% +26.90%   
**1-Year High**: XX% on 2025-07-17   
**1-Year Low**: XXXX% on 2025-01-06   
   
   
### Trading Volume: $XXXXXXXXXXXXXX [#](/topic/ethereum/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$79%   
**1 Month**: $XXXXXXXXXXXXXX +$119%   
**6 Months**: $XXXXXXXXXXXXXX +$76%   
**1 Year**: $XXXXXXXXXXXXXX +$144%   
**1-Year High**: $XXXXXXXXXXXXXX on 2025-02-27   
**1-Year Low**: $XXXXXXXXXXXXX on 2025-03-22   
   
   
### Market Dominance: XXXXX% [#](/topic/ethereum/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XX%   
**1-Year High**: XXXXX% on 2024-07-19   
**1-Year Low**: X% on 2025-04-10   
   
   
### Market Cap: $XXXXXXXXXXXXXXX [#](/topic/ethereum/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXXX +$23%   
**1 Month**: $XXXXXXXXXXXXXXX +$34%   
**6 Months**: $XXXXXXXXXXXXXXX -$1.10%   
**1 Year**: $XXXXXXXXXXXXXXX -$0.13%   
**1-Year High**: $XXXXXXXXXXXXXXX on 2024-12-06   
**1-Year Low**: $XXXXXXXXXXXXXXX on 2025-04-08   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/ethereum/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2025-05-01   
**1-Year Low**: XXXXXXXXXXX on 2024-07-18  

# Cardano 
[Cardano](/topic/cardano) 
Cardano's ecosystem is growing, with a XX% increase in spending on core areas last year and a surge in active addresses (38% in XX days) and new wallets (35,000 in XX days). The Cardano Foundation and Emurgo are also exploring new projects, including a potential partnership with the XRP ecosystem and a new art experience. Additionally, Cardano's founder, Charles Hoskinson, will advise US lawmakers on crypto regulation, which could positively impact the ecosystem. 

### Price: $XXXXX [#](/topic/cardano/close) 
--- 
The price is currently trending downwards due to short-term pullbacks and community discussions about treasury usage, and a decrease of XXXX% in the last XX days, despite positive social engagement, but recent news and social posts highlight potential for future growth.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| XXXX%  | XXXX%   | XXXXX% | XXXXX% |
 
**1-Year High**: $XXXX on 2024-12-06   
**1-Year Low**: $XXXXX on 2024-09-06   
   
   
### AltRank: XXX [#](/topic/cardano/alt_rank) 
--- 
Cardano (ADA) is currently AltRank #234 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +9   
**1 Month**: XXX -XXX   
**6 Months**: XXX -XX   
**1 Year**: XXX -XX   
**1-Year High**: XXXXX on 2025-06-26   
**1-Year Low**: X on 2024-09-03   
   
   
### Galaxy Score: XXXXX [#](/topic/cardano/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX +8   
**1 Month**: XX +2   
**6 Months**: XX +11   
**1 Year**: XX +4   
**1-Year High**: XX on 2025-05-08   
**1-Year Low**: XX on 2025-07-04   
   
   
### Engagements: XXXXXXXXX [#](/topic/cardano/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +43%   
**1 Month**: XXXXXXXXXXX +1.70%   
**6 Months**: XXXXXXXXXXX -XXXX%   
**1 Year**: XXXXXXXXXXXXX -XXXX%   
**1-Year High**: XXXXXXXXXX on 2025-03-03   
**1-Year Low**: XXXXXXX on 2025-07-17   
 
| Social Network | X         | TikTok | YouTube | Reddit | News   |
| -------------- | -         | ------ | ------- | ------ | ----   |
| Engagements    | XXXXXXXXX | XXXXXX | XXXXXXX | XXXXX  | XXXXXX |
  
 
   
   
### Mentions: XXXXXX [#](/topic/cardano/posts_active) 
--- 
**Current Value**: XXXXXX   
**Daily Average**: XXXXXX   
**1 Week**: XXXXXX +16%   
**1 Month**: XXXXXXX +88%   
**6 Months**: XXXXXXX -XX%   
**1 Year**: XXXXXXXXX -XXXX%   
**1-Year High**: XXXXXX on 2024-11-24   
**1-Year Low**: XXXXX on 2024-10-06   
 
| Social Network | X      | TikTok | YouTube | Reddit | News |
| -------------- | -      | ------ | ------- | ------ | ---- |
| Mentions       | XXXXXX | XXX    | XXXXX   | XXXXX  | XX   |
  
 
   
   
### Creators: XXXXX [#](/topic/cardano/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Cardano (ADA) in the last XX hours which is down XXXX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXXX -XXXX%   
**1 Month**: XXXXXX +68%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXXX -XXXX%   
**1-Year High**: XXXXXX on 2024-11-24   
**1-Year Low**: XXXXX on 2025-06-06   
 
The most influential creators that mention Cardano in the last XX hours 
 
| Creator                                                  | Rank | Followers | Posts | Engagements |
| -------                                                  | ---- | --------- | ----- | ----------- |
| [@TapTools](/creator/twitter/TapTools)                   | X    | XXXXXX    | XX    | XXXXXXX     |
| [@myfinancialfriend](/creator/youtube/myfinancialfriend) | X    | XXXXXXX   | XX    | XXXXXXX     |
| [@ApexFusion](/creator/twitter/ApexFusion)               | X    | XXXXXX    | X     | XXXXXX      |
| [@VirtualBacon0x](/creator/twitter/VirtualBacon0x)       | X    | XXXXXXX   | X     | XXXXXX      |
| [@Cardano_CF](/creator/twitter/Cardano_CF)               | X    | XXXXXXX   | XX    | XXXXXX      |
| [@Av_Sebastian](/creator/twitter/Av_Sebastian)           | X    | XXXXXX    | XX    | XXXXXX      |
| [@TheLongInvest](/creator/twitter/TheLongInvest)         | X    | XXXXXXX   | X     | XXXXXX      |
| [@StakeWithPride](/creator/twitter/StakeWithPride)       | X    | XXXXXX    | XX    | XXXXXX      |
| [@MinswapIntern](/creator/twitter/MinswapIntern)         | X    | XXXXXX    | XX    | XXXXXX      |
| [@ncash](/creator/youtube/ncash)                         | XX   | XXXXXXX   | X     | XXXXXX      |
 
[View More](/list/creators/cardano/100) 
   
   
### Sentiment: XX% [#](/topic/cardano/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% +1%   
**1 Year**: XX% +1%   
**1-Year High**: XX% on 2025-03-15   
**1-Year Low**: XX% on 2024-08-29   
 
**Most Supportive Themes** 
- **Ecosystem Growth, Community Solidarity, and Anticipation:** (45%) Cardano's ecosystem is experiencing growth with significant technical advancements and community support, especially with new developments and partnerships. 
   
**Most Critical Themes** 
- **Concerns over Past Financial Mismanagement:** (5%)  Concerns about past financial mismanagement are discussed in social posts. 
   
Network engagement breakdown:   
| Network | Positive  | %   | Neutral   | %   | Negative | %  |
| ------- | --------  | -   | -------   | -   | -------- | -  |
| X       | XXXXXXXXX | XX% | XXXXXXXXX | XX% | XXXXXXX  | X% |
| TikTok  | XXXXXX    | X%  | XXXXXX    | X%  | XXXXX    | X% |
| YouTube | XXXXXXX   | X%  | XXXXXXX   | X%  | XXXXXX   | X% |
| Reddit  | XXXXX     | X%  | XXX       | X%  | XXX      | X% |
| News    | XXXXXX    | X%  | XXX       | X%  | X        | X% |
|         |           |     |           |     |          |    |
| Total   | XXXXXXXXX | XX% | XXXXXXXXX | XX% | XXXXXXX  | X% |
  
 
   
   
### Social Dominance: XXXX% [#](/topic/cardano/social_dominance) 
--- 
**Current Value**: XXXX%   
**Daily Average**: XXXX%   
**1 Week**: XXXX% +0.803%   
**1 Month**: XXXX% +4.70%   
**6 Months**: XXXX% +4.90%   
**1 Year**: XXXX% +4.80%   
**1-Year High**: XXXXX% on 2025-07-17   
**1-Year Low**: XXXX% on 2024-10-16   
   
   
### Trading Volume: $XXXXXXXXXXXXX [#](/topic/cardano/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$64%   
**1 Month**: $XXXXXXXXXXXXX +$149%   
**6 Months**: $XXXXXXXXXXXXX +$7.20%   
**1 Year**: $XXXXXXXXXXXXX +$246%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-11-23   
**1-Year Low**: $XXXXXXXXXXX on 2024-08-31   
   
   
### Market Dominance: XXXXX% [#](/topic/cardano/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXX% on 2025-03-02   
**1-Year Low**: XXXXX% on 2024-10-31   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/cardano/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$22%   
**1 Month**: $XXXXXXXXXXXXXX +$20%   
**6 Months**: $XXXXXXXXXXXXXX -$33%   
**1 Year**: $XXXXXXXXXXXXXX +$76%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-12-06   
**1-Year Low**: $XXXXXXXXXXXXXX on 2024-09-06   
   
   
### Circulating Supply: XXXXXXXXXXXXXX [#](/topic/cardano/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXXX on 2025-07-13   
**1-Year Low**: XXXXXXXXXXXXXX on 2025-07-17  

# TRON 
[TRON](/topic/$trx) 
The BigOne exchange was recently hacked, resulting in a loss of over $XX million in various cryptocurrencies, including $X million worth of TRON ($trx). Meanwhile, TRON has been gaining attention due to its integration with Binance Alpha and a new trading sprint featuring a $3000 USDT prize pool in $trx. Additionally, TRON's user base is expected to surpass Ethereum's in Q3. 

### Price: $XXXXX [#](/topic/$trx/close) 
--- 
The price of TRX is trending upwards, supported by positive sentiment surrounding a potential US public listing, increased trading volume, and growing community engagement, with a current price of $XXXX. This is further bolstered by rising institutional interest and positive price changes across multiple timeframes.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| -XXXX% | XXXX%   | XXXX% | XXXXX% |
 
**1-Year High**: $XXXXX on 2024-12-03   
**1-Year Low**: $XXXXX on 2024-08-05   
   
   
### AltRank: XXX [#](/topic/$trx/alt_rank) 
--- 
TRON (TRX) is currently AltRank #279 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX -XXX   
**1 Month**: XXX -X   
**6 Months**: XXX -XXX   
**1 Year**: XXX -XXX   
**1-Year High**: XXXXX on 2024-12-09   
**1-Year Low**: X on 2024-12-03   
   
   
### Galaxy Score: XXXXX [#](/topic/$trx/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX no change   
**1 Month**: XX -XX   
**6 Months**: XX +28   
**1 Year**: XX +20   
**1-Year High**: XX on 2025-06-16   
**1-Year Low**: XX on 2024-11-01   
   
   
### Engagements: XXXXXXX [#](/topic/$trx/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX +50%   
**1 Month**: XXXXXXXXXX +14%   
**6 Months**: XXXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXXX +99%   
**1-Year High**: XXXXXXXXX on 2024-12-17   
**1-Year Low**: XXXXXX on 2024-08-09   
 
| Social Network | X       | TikTok | Reddit | YouTube |
| -------------- | -       | ------ | ------ | ------- |
| Engagements    | XXXXXXX | XXX    | XX     | XXX     |
  
 
   
   
### Mentions: XXXXX [#](/topic/$trx/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +10%   
**1 Month**: XXXXXX +48%   
**6 Months**: XXXXXXX +7.50%   
**1 Year**: XXXXXXX -XXXX%   
**1-Year High**: XXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2024-08-10   
 
| Social Network | X     | TikTok | Reddit | YouTube |
| -------------- | -     | ------ | ------ | ------- |
| Mentions       | XXXXX | X      | XX     | X       |
  
 
   
   
### Creators: XXX [#](/topic/$trx/contributors_active) 
--- 
XXX unique social accounts have posts mentioning TRON (TRX) in the last XX hours which is down XXXX% from XXX in the previous XX hours 
**Daily Average**: XXX   
**1 Week**: XXXXX -XX%   
**1 Month**: XXXXX +50%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXX +15%   
**1-Year High**: XXXXX on 2024-08-21   
**1-Year Low**: XXX on 2024-08-10   
 
The most influential creators that mention TRON in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@Meghan_Crypt](/creator/twitter/Meghan_Crypt)       | X    | XXXXXX    | X     | XXXXXX      |
| [@BigCheds](/creator/twitter/BigCheds)               | X    | XXXXXXX   | X     | XXXXXX      |
| [@Defi_Zee](/creator/twitter/Defi_Zee)               | X    | XXXXX     | X     | XXXXXX      |
| [@0xtega_](/creator/twitter/0xtega_)                 | X    | XXXXXX    | X     | XXXXXX      |
| [@Lucas_J30](/creator/twitter/Lucas_J30)             | X    | XXXXX     | XX    | XXXXX       |
| [@Oficial__odds](/creator/twitter/Oficial__odds)     | X    | XXX       | XX    | XXXXX       |
| [@justinSime36480](/creator/twitter/justinSime36480) | X    | XXX       | XX    | XXXXX       |
| [@RANDYBANKSSD](/creator/twitter/RANDYBANKSSD)       | X    | XXXXX     | XX    | XXXXX       |
| [@fern88656](/creator/twitter/fern88656)             | X    | XXXXX     | X     | XXXXX       |
| [@plzsats](/creator/twitter/plzsats)                 | XX   | XXXXX     | X     | XXXXX       |
 
[View More](/list/creators/$trx/100) 
   
   
### Sentiment: XX% [#](/topic/$trx/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-08-07   
**1-Year Low**: XX% on 2025-04-14   
 
**Most Supportive Themes** 
- **Staked TRX ETF Approval, Stripe Integration, and USDT Dominance:** (38%) Positive sentiment stems from the SEC acknowledging Canary Capital's filing for a staked TRX ETF, TRON's expanding integration with Stripe, and USDT dominance. 
- **TRON Going Public in the U.S.:** (60%) News regarding the public listing, along with strong community support and volume contribute to the positive sentiment. 
   
**Most Critical Themes** 
- **Centralization Risks and USDT Depeg:** (2%)  Concerns exist regarding centralization risks and potential depegging of USDD from USDT within the TRON ecosystem. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXX   | X% |
| TikTok  | XXX      | X%  | X       | X%  | X        | X% |
| Reddit  | XX       | X%  | X       | X%  | X        | X% |
| YouTube | X        | X%  | XXX     | X%  | X        | X% |
|         |          |     |         |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXX   | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/$trx/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.107%   
**1 Month**: XXXX% +0.591%   
**6 Months**: XXXX% +0.863%   
**1 Year**: XXXX% +0.70%   
**1-Year High**: XXXX% on 2024-08-21   
**1-Year Low**: XXXXX% on 2024-11-22   
   
   
### Trading Volume: $XXXXXXXXXXXXX [#](/topic/$trx/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$137%   
**1 Month**: $XXXXXXXXXXXXX -$24%   
**6 Months**: $XXXXXXXXXXXXX +$17%   
**1 Year**: $XXXXXXXXXXXXX +$155%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-12-04   
**1-Year Low**: $XXXXXXXXXXX on 2024-08-11   
   
   
### Market Dominance: XXXXX% [#](/topic/$trx/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-04-09   
**1-Year Low**: XXXXX% on 2024-07-22   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/$trx/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$6.40%   
**1 Month**: $XXXXXXXXXXXXXX +$13%   
**6 Months**: $XXXXXXXXXXXXXX +$37%   
**1 Year**: $XXXXXXXXXXXXXX +$152%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-12-03   
**1-Year Low**: $XXXXXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXXXXXX [#](/topic/$trx/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXXX on 2025-03-09   
**1-Year Low**: XXXXXXXXXXXXXX on 2025-03-08  

# BNB 
[BNB](/topic/binance-coin) 
BNB Chain is expanding its offerings through partnerships, including one with Ondo Finance to bring XXX US stocks, ETFs, and funds on-chain, enabling tokenized access to traditional assets. Windtree Therapeutics plans to launch a $200m crypto treasury strategy with direct BNB exposure, becoming the first Nasdaq-listed company to do so. Additionally, several projects and developers are building on BNB Chain, including a new DEX called Squad Swap and various initiatives to foster innovation and adoption. 

### Price: $XXXXXX [#](/topic/binance-coin/close) 
--- 
BNB's price is experiencing upward pressure due to positive news, an increase in trading volume, and bullish sentiment. The recent token burn, Nano Labs' convertible notes deal, and Binance's staking opportunities contribute to the positive market reaction, likely leading to further price increases in the short term.   
 
| 1-Hour | 24-Hour | 7-Day | 30-Day |
| ------ | ------- | ----- | ------ |
| XXXX%  | XXXX%   | XXXX% | XXXXX% |
 
**1-Year High**: $XXXXXX on 2024-12-07   
**1-Year Low**: $XXXXXX on 2024-08-05   
   
   
### AltRank: XXX [#](/topic/binance-coin/alt_rank) 
--- 
BNB (BNB) is currently AltRank #188 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX -XXX   
**1 Month**: XXX +162   
**6 Months**: XXX +30   
**1 Year**: XXX -XX   
**1-Year High**: XXXXX on 2025-04-23   
**1-Year Low**: X on 2025-02-16   
   
   
### Galaxy Score: XXXXX [#](/topic/binance-coin/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -X   
**1 Month**: XX no change   
**6 Months**: XX -X   
**1 Year**: XX +13   
**1-Year High**: XX on 2025-03-24   
**1-Year Low**: XX on 2025-05-30   
   
   
### Engagements: XXXXXXXXX [#](/topic/binance-coin/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +38%   
**1 Month**: XXXXXXXXXX -XX%   
**6 Months**: XXXXXXXXXXX +24%   
**1 Year**: XXXXXXXXXXX -XX%   
**1-Year High**: XXXXXXXXX on 2024-12-04   
**1-Year Low**: XXXXXXX on 2025-07-17   
 
| Social Network | X         | TikTok | YouTube | Reddit | News |
| -------------- | -         | ------ | ------- | ------ | ---- |
| Engagements    | XXXXXXXXX | XXXXX  | XXXXX   | XXX    | XXX  |
  
 
   
   
### Mentions: XXXXX [#](/topic/binance-coin/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +8.80%   
**1 Month**: XXXXXX +25%   
**6 Months**: XXXXXXX -XXXX%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2024-09-08   
 
| Social Network | X      | TikTok | YouTube | Reddit | News |
| -------------- | -      | ------ | ------- | ------ | ---- |
| Mentions       | XXXXXX | XX     | XXX     | XX     | X    |
  
 
   
   
### Creators: XXXXX [#](/topic/binance-coin/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning BNB (BNB) in the last XX hours which is down XX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +6.30%   
**1 Month**: XXXXXX +41%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2024-09-08   
 
The most influential creators that mention BNB in the last XX hours 
 
| Creator                                            | Rank | Followers | Posts | Engagements |
| -------                                            | ---- | --------- | ----- | ----------- |
| [@VirtualBacon0x](/creator/twitter/VirtualBacon0x) | X    | XXXXXXX   | X     | XXXXXX      |
| [@Cointelegraph](/creator/twitter/Cointelegraph)   | X    | XXXXXXXXX | X     | XXXXXX      |
| [@bingerloud](/creator/twitter/bingerloud)         | X    | XXX       | XX    | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)     | X    | XXXXX     | XX    | XXXXXX      |
| [@Oficial__odds](/creator/twitter/Oficial__odds)   | X    | XXX       | XX    | XXXXXX      |
| [@BigCheds](/creator/twitter/BigCheds)             | X    | XXXXXXX   | X     | XXXXXX      |
| [@HiKARUD_FXXK](/creator/twitter/HiKARUD_FXXK)     | X    | XXX       | XX    | XXXXXX      |
| [@CryptosBatman](/creator/twitter/CryptosBatman)   | X    | XXXXXX    | X     | XXXXXX      |
| [@AllajuneCrypto](/creator/twitter/AllajuneCrypto) | X    | XXXXX     | XX    | XXXXXX      |
| [@drphil11](/creator/twitter/drphil11)             | XX   | XX        | XX    | XXXXXX      |
 
[View More](/list/creators/binance-coin/100) 
   
   
### Sentiment: XX% [#](/topic/binance-coin/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% no change   
**1 Year**: XX% no change   
**1-Year High**: XX% on 2025-02-15   
**1-Year Low**: XX% on 2025-04-18   
 
**Most Supportive Themes** 
- **Bullish Momentum and Positive Sentiment:** (45%) Posts express optimism about BNB's potential, highlighting its strong performance, increased DEX volume, and positive technical indicators. 
- **Ecosystem Growth and New Opportunities:** (30%) Posts highlight the expanding Binance ecosystem, including new Launchpool projects and the integration of BNB Chain with various platforms. 
- **Recognition and Institutional Interest:** (15%) Posts highlight the expanding Binance ecosystem, including new Launchpool projects and the integration of BNB Chain with various platforms. 
   
**Most Critical Themes** 
- **Scam and Security Concerns & Competition and Market Dynamics:** (5%)  Posts express warnings about potential scams, security issues, and competition within the market. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXXX  | X% |
| TikTok  | XXX      | X%  | XXXXX   | X%  | XXX      | X% |
| YouTube | XXXXX    | X%  | XXXXX   | X%  | XXX      | X% |
| Reddit  | XX       | X%  | XX      | X%  | X        | X% |
| News    | XXX      | X%  | X       | X%  | X        | X% |
|         |          |     |         |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXXX  | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/binance-coin/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.238%   
**1 Month**: XXXX% +3.70%   
**6 Months**: XXXX% +4%   
**1 Year**: XXXX% +3.70%   
**1-Year High**: XXXX% on 2025-07-17   
**1-Year Low**: XXXXX% on 2025-07-01   
   
   
### Trading Volume: $XXXXXXXXXXXXX [#](/topic/binance-coin/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$61%   
**1 Month**: $XXXXXXXXXXXXX +$74%   
**6 Months**: $XXXXXXXXXXXXX +$175%   
**1 Year**: $XXXXXXXXXXXXX +$33%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-12-04   
**1-Year Low**: $XXXXXXXXXXX on 2025-06-29   
   
   
### Market Dominance: XXXX% [#](/topic/binance-coin/market_dominance) 
--- 
**Current Value**: XXXX%   
**Daily Average**: X%   
**1-Year High**: X% on 2024-08-23   
**1-Year Low**: XXXX% on 2025-02-04   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/binance-coin/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$2%   
**1 Month**: $XXXXXXXXXXXXXX +$5%   
**6 Months**: $XXXXXXXXXXXXXX -$5.20%   
**1 Year**: $XXXXXXXXXXXXXX +$12%   
**1-Year High**: $XXXXXXXXXXXXXXX on 2024-12-07   
**1-Year Low**: $XXXXXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/binance-coin/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-07-18   
**1-Year Low**: XXXXXXXXXXX on 2025-07-17  

# Hyperliquid 
[Hyperliquid](/topic/$hype) 
Hyperliquid's native token $HYPE has seen significant activity, with large trades and notable investors involved. A major development is that Enso now powers swaps and deposits into $kHYPE, the liquid staked version of $HYPE, with $420M deposited in the first XX hours. Additionally, Hyperliquid's Phantom Perps have reportedly generated over $3M in revenue every weekday since launch. 

### Price: $XXXXX [#](/topic/$hype/close) 
--- 
The current price of $HYPE is trending upwards due to high trading volume, strong fundamentals, positive social sentiment, and the platform's overall growth. The all-time high price of $XXXXX and the anticipation of upcoming events such as a large token unlock, along with institutional adoption, are contributing to the bullish momentum.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| -XXXX% | -XXXX%  | XXXXX% | XXXX%  |
 
**1-Year High**: $XXXXX on 2025-07-13   
**1-Year Low**: $XXXX on 2024-11-29   
   
   
### AltRank: XXXXX [#](/topic/$hype/alt_rank) 
--- 
Hyperliquid (HYPE) is currently AltRank #1,404 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXXXX +1,180   
**1 Month**: XXXXX +1,234   
**6 Months**: XXXXX +128   
**1-Year High**: XXXXX on 2025-03-16   
**1-Year Low**: X on 2025-05-25   
   
   
### Galaxy Score: XXXXX [#](/topic/$hype/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX -XX   
**6 Months**: XX -X   
**1-Year High**: XX on 2025-05-22   
**1-Year Low**: XX on 2025-05-27   
   
   
### Engagements: XXXXXXXXX [#](/topic/$hype/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +76%   
**1 Month**: XXXXXXXXXX -XXXX%   
**6 Months**: XXXXXXXXXXX +12%   
**1 Year**: XXXXXXXXXXX +3,754%   
**1-Year High**: XXXXXXXXXX on 2024-12-22   
**1-Year Low**: XXXXX on 2024-09-15   
 
| Social Network | X         | Reddit | TikTok | YouTube |
| -------------- | -         | ------ | ------ | ------- |
| Engagements    | XXXXXXXXX | XX     | XXXXX  | XX      |
  
 
   
   
### Mentions: XXXXX [#](/topic/$hype/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +20%   
**1 Month**: XXXXXX +38%   
**6 Months**: XXXXXXX +101%   
**1 Year**: XXXXXXX +2,961%   
**1-Year High**: XXXXXX on 2024-12-16   
**1-Year Low**: XX on 2024-09-12   
 
| Social Network | X      | Reddit | TikTok | YouTube |
| -------------- | -      | ------ | ------ | ------- |
| Mentions       | XXXXXX | X      | XX     | XX      |
  
 
   
   
### Creators: XXXXX [#](/topic/$hype/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Hyperliquid (HYPE) in the last XX hours which is down XX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +39%   
**1 Month**: XXXXXX +52%   
**6 Months**: XXXXXX -XXXX%   
**1 Year**: XXXXXX +5,897%   
**1-Year High**: XXXXXX on 2024-12-16   
**1-Year Low**: XX on 2024-07-21   
 
The most influential creators that mention Hyperliquid in the last XX hours 
 
| Creator                                          | Rank | Followers | Posts | Engagements |
| -------                                          | ---- | --------- | ----- | ----------- |
| [@theunipcs](/creator/twitter/theunipcs)         | X    | XXXXXXX   | X     | XXXXXXX     |
| [@katexbt](/creator/twitter/katexbt)             | X    | XXXXXX    | X     | XXXXXX      |
| [@BigCheds](/creator/twitter/BigCheds)           | X    | XXXXXXX   | X     | XXXXXX      |
| [@bingerloud](/creator/twitter/bingerloud)       | X    | XXX       | XX    | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)   | X    | XXXXX     | XX    | XXXXXX      |
| [@FloodCapital](/creator/twitter/FloodCapital)   | X    | XXXXXX    | X     | XXXXXX      |
| [@reisnertobias](/creator/twitter/reisnertobias) | X    | XXXXXX    | X     | XXXXXX      |
| [@degennQuant](/creator/twitter/degennQuant)     | X    | XXXXX     | XX    | XXXXXX      |
| [@Oficial__odds](/creator/twitter/Oficial__odds) | X    | XXX       | XX    | XXXXXX      |
| [@OnchainLens](/creator/twitter/OnchainLens)     | XX   | XXXXXX    | X     | XXXXXX      |
 
[View More](/list/creators/$hype/100) 
   
   
### Sentiment: XX% [#](/topic/$hype/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XXX% on 2024-09-09   
**1-Year Low**: XX% on 2025-03-27   
 
**Most Supportive Themes** 
- **Strong Fundamentals and Revenue Generation:** (47%) Positive sentiment is driven by strong fundamentals, revenue generation, and community engagement. 
- **Growing Market Share and Ecosystem:** (36%) Positive sentiment builds around growing market share, the growing ecosystem on HyperEVM, along with staking and farming opportunities. 
- **Staking and Farming Opportunities:** (15%) Enthusiasm surrounding staking and farming opportunities within the HyperEVM ecosystem and potential airdrops. 
   
**Most Critical Themes** 
- **Concerns about Unstaking and Profit Taking:** (8%)  Concerns about potential sell-offs from unstaking and profit-taking. 
   
Network engagement breakdown:   
| Network | Positive | %    | Neutral | %   | Negative | %  |
| ------- | -------- | -    | ------- | -   | -------- | -  |
| X       | XXXXXXX  | XX%  | XXXXXXX | XX% | XXXXXXX  | X% |
| Reddit  | X        | X%   | XX      | X%  | X        | X% |
| TikTok  | XXX      | X%   | XXX     | X%  | XX       | X% |
| YouTube | X        | XXX% | XX      | X%  | X        | X% |
|         |          |      |         |     |          |    |
| Total   | XXXXXXX  | XX%  | XXXXXXX | XX% | XXXXXXX  | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/$hype/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXX%   
**1 Week**: XXXXX% +0.024%   
**1 Month**: XXXX% +2.90%   
**6 Months**: XXXX% +3.20%   
**1 Year**: XXXX% +3.50%   
**1-Year High**: X% on 2025-07-17   
**1-Year Low**: XXXXXX% on 2024-09-12   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/$hype/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX +$40%   
**1 Month**: $XXXXXXXXXXX +$1.70%   
**6 Months**: $XXXXXXXXXXX +$222%   
**1-Year High**: $XXXXXXXXXXX on 2025-06-13   
**1-Year Low**: $XXXXXXXXXX on 2025-03-01   
   
   
### Market Dominance: XXXXX% [#](/topic/$hype/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-07-13   
**1-Year Low**: XXXXX% on 2024-11-29   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/$hype/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$12%   
**1 Month**: $XXXXXXXXXXXXXX +$9.60%   
**6 Months**: $XXXXXXXXXXXXXX +$101%   
**1-Year High**: $XXXXXXXXXXXXXX on 2025-07-13   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-11-29   
   
   
### Circulating Supply: XXXXXXXXXXX [#](/topic/$hype/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXX on 2024-11-29   
**1-Year Low**: XXXXXXXXXXX on 2024-11-29  

# Hedera 
[Hedera](/topic/$hbar) 
Hedera is gaining attention for its real-world adoption, particularly with institutional validation from NVIDIA, Grayscale, Lloyds Bank, and a national CBDC pilot. The Hedera Foundation has also unveiled "Hedera to Earn", a major new rewards initiative designed to bring XX million users to the network. Additionally, tokenized assets and financial institutions are being developed on the Hedera network. 

### Price: $XXXXX [#](/topic/$hbar/close) 
--- 
The current price of HBAR is experiencing positive short-term price pressure due to increased trading volume, bullish sentiment surrounding institutional adoption, partnerships, and potential ETF approval, and has seen a XXXXX% increase in XX hours and is currently at $XXXXX. This is likely to lead to a breakout above $XXXX.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| XXXX%  | XXXX%   | XXXXX% | XXXXX% |
 
**1-Year High**: $XXXXX on 2025-01-17   
**1-Year Low**: $XXXXX on 2024-11-04   
   
   
### AltRank: XXX [#](/topic/$hbar/alt_rank) 
--- 
Hedera (HBAR) is currently AltRank #244 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +386   
**1 Month**: XXX -XXX   
**6 Months**: XXX +84   
**1 Year**: XXX +140   
**1-Year High**: XXXXX on 2025-04-15   
**1-Year Low**: X on 2024-09-05   
   
   
### Galaxy Score: XXXXX [#](/topic/$hbar/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX +6   
**1 Month**: XX +17   
**6 Months**: XX +18   
**1 Year**: XX no change   
**1-Year High**: XX on 2025-07-13   
**1-Year Low**: XX on 2025-05-29   
   
   
### Engagements: XXXXXXXXX [#](/topic/$hbar/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +75%   
**1 Month**: XXXXXXXXXX +45%   
**6 Months**: XXXXXXXXXXX -XXXX%   
**1 Year**: XXXXXXXXXXX +45%   
**1-Year High**: XXXXXXXXXX on 2024-12-03   
**1-Year Low**: XXXXXXX on 2024-11-01   
 
| Social Network | X         | TikTok | YouTube | Reddit | News |
| -------------- | -         | ------ | ------- | ------ | ---- |
| Engagements    | XXXXXXXXX | XXX    | XXXXX   | XX     | X    |
  
 
   
   
### Mentions: XXXXX [#](/topic/$hbar/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +15%   
**1 Month**: XXXXXX +117%   
**6 Months**: XXXXXXX +2.10%   
**1 Year**: XXXXXXX +40%   
**1-Year High**: XXXXXX on 2024-12-04   
**1-Year Low**: XXXXX on 2024-10-06   
 
| Social Network | X      | TikTok | YouTube | Reddit | News |
| -------------- | -      | ------ | ------- | ------ | ---- |
| Mentions       | XXXXXX | XX     | XX      | XX     | X    |
  
 
   
   
### Creators: XXXXX [#](/topic/$hbar/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Hedera (HBAR) in the last XX hours which is down XX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +35%   
**1 Month**: XXXXX +51%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXX +28%   
**1-Year High**: XXXXX on 2024-12-04   
**1-Year Low**: XXX on 2024-10-06   
 
The most influential creators that mention Hedera in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@TapTools](/creator/twitter/TapTools)               | X    | XXXXXX    | X     | XXXXXXX     |
| [@RealAllinCrypto](/creator/twitter/RealAllinCrypto) | X    | XXXXXX    | XX    | XXXXXX      |
| [@B_arri_C](/creator/twitter/B_arri_C)               | X    | XXXXXX    | X     | XXXXXX      |
| [@markchadwickx](/creator/twitter/markchadwickx)     | X    | XXXXXX    | XX    | XXXXXX      |
| [@MerlijnTrader](/creator/twitter/MerlijnTrader)     | X    | XXXXXXX   | X     | XXXXXX      |
| [@Steph_iscrypto](/creator/twitter/Steph_iscrypto)   | X    | XXXXXX    | X     | XXXXXX      |
| [@Gilmore_Estates](/creator/twitter/Gilmore_Estates) | X    | XXXXXX    | XX    | XXXXXX      |
| [@RDiamondhands](/creator/twitter/RDiamondhands)     | X    | XXX       | X     | XXXXXX      |
| [@SkartusNFT](/creator/twitter/SkartusNFT)           | X    | XXXXX     | X     | XXXXXX      |
| [@oroogle](/creator/twitter/oroogle)                 | XX   | XXXXXX    | X     | XXXXXX      |
 
[View More](/list/creators/$hbar/100) 
   
   
### Sentiment: XX% [#](/topic/$hbar/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% +1%   
**1 Month**: XX% -X%   
**6 Months**: XX% no change   
**1 Year**: XX% +1%   
**1-Year High**: XX% on 2025-03-15   
**1-Year Low**: XX% on 2025-04-02   
 
**Most Supportive Themes** 
- **Institutional Adoption and Real-World Asset (RWA) Tokenization:** (35%) Hedera's increasing institutional adoption and partnerships with major companies in RWA tokenization are driving positive sentiment, with technological advancements and ecosystem growth also contributing to the positive outlook. 
- **Technological Advancements and Ecosystem Growth:** (30%) Hedera's technological capabilities and the expanding ecosystem with new projects and DeFi opportunities are garnering attention. Bullish sentiment towards HBAR, with price predictions driven by positive technical indicators and market catalysts is present in the community 
- **Bullish Sentiment and Price Predictions:** (25%) Bullish sentiment towards HBAR, with price predictions driven by positive technical indicators and market catalysts. 
   
**Most Critical Themes** 
- **Centralization Concerns and Ecosystem Critique:** (7%)  Concerns about centralization and criticisms within the ecosystem are being discussed by a small portion of the community. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral   | %   | Negative | %  |
| ------- | -------- | -   | -------   | -   | -------- | -  |
| X       | XXXXXXX  | XX% | XXXXXXXXX | XX% | XXXXXX   | X% |
| TikTok  | X        | X%  | XXX       | X%  | X        | X% |
| YouTube | XXXXX    | X%  | XXX       | X%  | X        | X% |
| Reddit  | XX       | X%  | XX        | X%  | XX       | X% |
| News    | X        | X%  | X         | X%  | X        | X% |
|         |          |     |           |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXXXX | XX% | XXXXXX   | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/$hbar/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% +0.13%   
**1 Month**: XXXX% +3.20%   
**6 Months**: XXXX% +3.10%   
**1 Year**: XXXX% +3.30%   
**1-Year High**: XXXX% on 2025-07-17   
**1-Year Low**: XXXXX% on 2024-11-09   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/$hbar/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX +$115%   
**1 Month**: $XXXXXXXXXXX +$343%   
**6 Months**: $XXXXXXXXXXX -$53%   
**1 Year**: $XXXXXXXXXXX +$1,208%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-12-03   
**1-Year Low**: $XXXXXXXXXX on 2024-09-14   
   
   
### Market Dominance: XXXXX% [#](/topic/$hbar/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-01-17   
**1-Year Low**: XXXXX% on 2024-11-03   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/$hbar/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$36%   
**1 Month**: $XXXXXXXXXXXXXX +$55%   
**6 Months**: $XXXXXXXXXXXXXX -$30%   
**1 Year**: $XXXXXXXXXXXXXX +$269%   
**1-Year High**: $XXXXXXXXXXXXXX on 2025-01-17   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-11-04   
   
   
### Circulating Supply: XXXXXXXXXXXXXX [#](/topic/$hbar/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXXX on 2025-07-15   
**1-Year Low**: XXXXXXXXXXXXXX on 2024-07-19  

# Sui 
[Sui](/topic/$sui) 
Sui has seen significant growth, with its stablecoin market cap hitting a new all-time high of $XXXX billion. Additionally, DeFi Technologies reported an all-time high in Sui assets under management and treasury holdings, surpassing $XXXX million and $XXXX million, respectively. Sui has also been trending on CoinGecko and has broken out with a XX% pump in XX days, leading the crypto market. 

### Price: $X [#](/topic/$sui/close) 
--- 
Sui's price is currently in a downtrend but appears to be leveling out with a slight bullish bias, as indicated by the leveling out of the price chart and the potential for increased prices from positive social sentiment, tBTC launch and news from Grayscale.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| XXXX%  | XXXX%   | XXXXX% | XXXXX% |
 
**1-Year High**: $XXXX on 2025-01-04   
**1-Year Low**: $XXXXX on 2024-08-05   
   
   
### AltRank: XXX [#](/topic/$sui/alt_rank) 
--- 
Sui (SUI) is currently AltRank #622 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +438   
**1 Month**: XXX -XXX   
**6 Months**: XXX +72   
**1 Year**: XXX +393   
**1-Year High**: XXXXX on 2025-05-26   
**1-Year Low**: X on 2024-11-09   
   
   
### Galaxy Score: XXXXX [#](/topic/$sui/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -X   
**1 Month**: XX +11   
**6 Months**: XX +18   
**1 Year**: XX +28   
**1-Year High**: XX on 2025-04-22   
**1-Year Low**: XX on 2025-05-29   
   
   
### Engagements: XXXXXXXXX [#](/topic/$sui/interactions) 
--- 
**Current Value**: XXXXXXXXX   
**Daily Average**: XXXXXXXXX   
**1 Week**: XXXXXXXXXX +54%   
**1 Month**: XXXXXXXXXX -XX%   
**6 Months**: XXXXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXXX +155%   
**1-Year High**: XXXXXXXXXX on 2025-05-22   
**1-Year Low**: XXXXXXX on 2024-08-06   
 
| Social Network | X         | TikTok | YouTube | Reddit |
| -------------- | -         | ------ | ------- | ------ |
| Engagements    | XXXXXXXXX | XXXXX  | XXX     | XX     |
  
 
   
   
### Mentions: XXXXXX [#](/topic/$sui/posts_active) 
--- 
**Current Value**: XXXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXXX +21%   
**1 Month**: XXXXXXX +67%   
**6 Months**: XXXXXXX -XXXX%   
**1 Year**: XXXXXXX +83%   
**1-Year High**: XXXXXX on 2025-01-05   
**1-Year Low**: XXXXX on 2024-09-02   
 
| Social Network | X      | TikTok | YouTube | Reddit |
| -------------- | -      | ------ | ------- | ------ |
| Mentions       | XXXXXX | XX     | XX      | XX     |
  
 
   
   
### Creators: XXXXX [#](/topic/$sui/contributors_active) 
--- 
XXXXX unique social accounts have posts mentioning Sui (SUI) in the last XX hours which is down XXXX% from XXXXX in the previous XX hours 
**Daily Average**: XXXXX   
**1 Week**: XXXXX +9.60%   
**1 Month**: XXXXXX +19%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXXX +154%   
**1-Year High**: XXXXX on 2024-12-27   
**1-Year Low**: XXXXX on 2024-09-02   
 
The most influential creators that mention Sui in the last XX hours 
 
| Creator                                              | Rank | Followers | Posts | Engagements |
| -------                                              | ---- | --------- | ----- | ----------- |
| [@Grayscale](/creator/twitter/Grayscale)             | X    | XXXXXXX   | X     | XXXXXX      |
| [@WalrusProtocol](/creator/twitter/WalrusProtocol)   | X    | XXXXXXX   | X     | XXXXXX      |
| [@kyle_chasse](/creator/twitter/kyle_chasse)         | X    | XXXXXXX   | X     | XXXXXX      |
| [@martypartymusic](/creator/twitter/martypartymusic) | X    | XXXXXXX   | X     | XXXXXX      |
| [@AltCryptoGems](/creator/twitter/AltCryptoGems)     | X    | XXXXXXX   | X     | XXXXXX      |
| [@AltcoinGordon](/creator/twitter/AltcoinGordon)     | X    | XXXXXXX   | X     | XXXXXX      |
| [@bingerloud](/creator/twitter/bingerloud)           | X    | XXX       | XX    | XXXXXX      |
| [@Oficial__odds](/creator/twitter/Oficial__odds)     | X    | XXX       | XX    | XXXXXX      |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)       | X    | XXXXX     | XX    | XXXXXX      |
| [@cryptofergani](/creator/twitter/cryptofergani)     | XX   | XXXXXX    | X     | XXXXXX      |
 
[View More](/list/creators/$sui/100) 
   
   
### Sentiment: XX% [#](/topic/$sui/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -X%   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% no change   
**1-Year High**: XX% on 2025-03-05   
**1-Year Low**: XX% on 2025-05-22   
 
**Most Supportive Themes** 
- **Community and Developer Response to Cetus Hack and belief in Sui's Technology and Ecosystem:** (35%) Many users express confidence in Sui's technology, ecosystem, community, and developers, especially after the Cetus exploit and the project's long-term potential. 
   
**Most Critical Themes** 
- **Concerns over Centralization and Security Risks and DeFi Exploits:** (6%)  Concerns over centralization, security risks, and DeFi exploits within the Sui ecosystem are being discussed. 
   
Network engagement breakdown:   
| Network | Positive | %    | Neutral   | %   | Negative | %  |
| ------- | -------- | -    | -------   | -   | -------- | -  |
| X       | XXXXXXX  | XX%  | XXXXXXXXX | XX% | XXXXXXX  | X% |
| TikTok  | X        | XXX% | XXXXX     | X%  | X        | X% |
| YouTube | XXX      | X%   | XXX       | X%  | X        | X% |
| Reddit  | X        | X%   | X         | X%  | X        | X% |
|         |          |      |           |     |          |    |
| Total   | XXXXXXX  | XX%  | XXXXXXXXX | XX% | XXXXXXX  | X% |
  
 
   
   
### Social Dominance: XXXX% [#](/topic/$sui/social_dominance) 
--- 
**Current Value**: XXXX%   
**Daily Average**: X%   
**1 Week**: X% +0.869%   
**1 Month**: XXXX% +2.60%   
**6 Months**: XXXX% +2.70%   
**1 Year**: XXXX% +3.20%   
**1-Year High**: XXXX% on 2025-07-17   
**1-Year Low**: XXXXX% on 2024-08-06   
   
   
### Trading Volume: $XXXXXXXXXXXXX [#](/topic/$sui/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX +$70%   
**1 Month**: $XXXXXXXXXXXXX +$93%   
**6 Months**: $XXXXXXXXXXXXX +$58%   
**1 Year**: $XXXXXXXXXXXXX +$931%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-12-05   
**1-Year Low**: $XXXXXXXXXX on 2024-07-28   
   
   
### Market Dominance: XXXXX% [#](/topic/$sui/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2025-01-10   
**1-Year Low**: XXXX% on 2024-08-04   
   
   
### Market Cap: $XXXXXXXXXXXXXX [#](/topic/$sui/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXXX +$25%   
**1 Month**: $XXXXXXXXXXXXXX +$35%   
**6 Months**: $XXXXXXXXXXXXXX -$5.90%   
**1 Year**: $XXXXXXXXXXXXXX +$533%   
**1-Year High**: $XXXXXXXXXXXXXX on 2025-01-04   
**1-Year Low**: $XXXXXXXXXXXXX on 2024-08-05   
   
   
### Circulating Supply: XXXXXXXXXXXXX [#](/topic/$sui/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXXXXX   
**Daily Average**: XXXXXXXXXXXXX   
**1-Year High**: XXXXXXXXXXXXX on 2025-07-01   
**1-Year Low**: XXXXXXXXXXXXX on 2024-07-18  

# Bitcoin Cash 
[Bitcoin Cash](/topic/bitcoin-cash) 
Tether has announced it will discontinue USDT redemptions on several blockchain networks, including Bitcoin Cash. The Bitcoin Cash community is actively promoting the use of BCH for everyday transactions and has been experimenting with exposing naked shorting used by exchanges. Additionally, there are reports of increased adoption, with some merchants and platforms starting to accept BCH as payment. 

### Price: $XXXXXX [#](/topic/bitcoin-cash/close) 
--- 
Bitcoin Cash is currently experiencing bullish momentum, trading at $504.50, up XXXX% in the last XX hours, due to increased trading volume, positive social engagement, and positive sentiment surrounding news of potential whale activity and a golden cross pattern.   
 
| 1-Hour | 24-Hour | 7-Day  | 30-Day |
| ------ | ------- | -----  | ------ |
| XXXX%  | -XXXX%  | -XXXX% | XXXX%  |
 
**1-Year High**: $XXXXXX on 2024-12-06   
**1-Year Low**: $XXXXXX on 2025-04-08   
   
   
### AltRank: XXXXX [#](/topic/bitcoin-cash/alt_rank) 
--- 
Bitcoin Cash (BCH) is currently AltRank #1,042 based on combined combined social and market metrics 
**Daily Average**: XXX   
**1 Week**: XXX +194   
**1 Month**: XXX +503   
**6 Months**: XXX +487   
**1 Year**: XXX +326   
**1-Year High**: XXXXX on 2025-03-13   
**1-Year Low**: X on 2024-07-28   
   
   
### Galaxy Score: XXXXX [#](/topic/bitcoin-cash/galaxy_score) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XX   
**1 Week**: XX -XX   
**1 Month**: XX -XX   
**6 Months**: XX -XX   
**1 Year**: XX -XX   
**1-Year High**: XX on 2025-06-19   
**1-Year Low**: XX on 2025-05-01   
   
   
### Engagements: XXXXXXX [#](/topic/bitcoin-cash/interactions) 
--- 
**Current Value**: XXXXXXX   
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXXXX +10%   
**1 Month**: XXXXXXXXXX +125%   
**6 Months**: XXXXXXXXXX -XX%   
**1 Year**: XXXXXXXXXX -XX%   
**1-Year High**: XXXXXXXXX on 2024-11-27   
**1-Year Low**: XXXXXX on 2025-07-17   
 
| Social Network | X       | Reddit | YouTube | TikTok | News |
| -------------- | -       | ------ | ------- | ------ | ---- |
| Engagements    | XXXXXXX | XXX    | XXXXXX  | XXX    | XX   |
  
 
   
   
### Mentions: XXXXX [#](/topic/bitcoin-cash/posts_active) 
--- 
**Current Value**: XXXXX   
**Daily Average**: XXXXX   
**1 Week**: XXXXX +5.10%   
**1 Month**: XXXXXX +92%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXXX -XX%   
**1-Year High**: XXXXX on 2024-07-29   
**1-Year Low**: XXX on 2024-10-03   
 
| Social Network | X     | Reddit | YouTube | TikTok | News |
| -------------- | -     | ------ | ------- | ------ | ---- |
| Mentions       | XXXXX | XXX    | XXX     | XX     | XX   |
  
 
   
   
### Creators: XXX [#](/topic/bitcoin-cash/contributors_active) 
--- 
XXX unique social accounts have posts mentioning Bitcoin Cash (BCH) in the last XX hours which is down XX% from XXX in the previous XX hours 
**Daily Average**: XXX   
**1 Week**: XXXXX -XX%   
**1 Month**: XXXXX +72%   
**6 Months**: XXXXXX -XX%   
**1 Year**: XXXXXX -XX%   
**1-Year High**: XXXXX on 2024-11-28   
**1-Year Low**: XXX on 2024-10-02   
 
The most influential creators that mention Bitcoin Cash in the last XX hours 
 
| Creator                                            | Rank | Followers | Posts | Engagements |
| -------                                            | ---- | --------- | ----- | ----------- |
| [@BigCheds](/creator/twitter/BigCheds)             | X    | XXXXXXX   | X     | XXXXXX      |
| [@plzsats](/creator/twitter/plzsats)               | X    | XXXXX     | XX    | XXXXX       |
| [@Oficial__odds](/creator/twitter/Oficial__odds)   | X    | XXX       | XX    | XXXXX       |
| [@CryptoFeras](/creator/twitter/CryptoFeras)       | X    | XXXXXX    | X     | XXXXX       |
| [@bingerloud](/creator/twitter/bingerloud)         | X    | XXX       | XX    | XXXXX       |
| [@CRYPTO_BONAZ](/creator/twitter/CRYPTO_BONAZ)     | X    | XXXXX     | XX    | XXXXX       |
| [@captaindwork](/creator/twitter/captaindwork)     | X    | XXXXX     | X     | XXXXX       |
| [@AllajuneCrypto](/creator/twitter/AllajuneCrypto) | X    | XXXXXX    | XX    | XXXXX       |
| [@Aurelia_fx](/creator/twitter/Aurelia_fx)         | X    | XXX       | XX    | XXXXX       |
| [@MANUAL_CRYPTOO](/creator/twitter/MANUAL_CRYPTOO) | XX   | XXXXX     | XX    | XXXXX       |
 
[View More](/list/creators/bitcoin-cash/100) 
   
   
### Sentiment: XX% [#](/topic/bitcoin-cash/sentiment) 
--- 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% -XX%   
**1 Month**: XX% -X%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-09-24   
**1-Year Low**: XX% on 2024-11-20   
 
**Most Supportive Themes** 
- **Increased Adoption and Community Engagement:** (60%) Increased adoption and community engagement are driving bullish momentum, advocating Bitcoin Cash as electronic cash, with high engagement on social media. 
- **Advocacy for Bitcoin Cash as Electronic Cash:** (37%) Bitcoin Cash is recognized for its utility as peer-to-peer electronic cash, with many supporting the coin's usage for everyday purchases and transactions. 
   
**Most Critical Themes** 
- **Concerns about Transaction Fees:** (2%)  Concerns about high transaction fees are hindering the adoption and growth of Bitcoin Cash. 
   
Network engagement breakdown:   
| Network | Positive | %   | Neutral | %   | Negative | %  |
| ------- | -------- | -   | ------- | -   | -------- | -  |
| X       | XXXXXX   | XX% | XXXXXXX | XX% | XXXXXX   | X% |
| Reddit  | XXX      | X%  | XXX     | X%  | XX       | X% |
| YouTube | XXXXXX   | XX% | XXXXX   | X%  | XXXXX    | X% |
| TikTok  | XX       | X%  | XXX     | X%  | X        | X% |
| News    | XX       | X%  | X       | X%  | X        | X% |
|         |          |     |         |     |          |    |
| Total   | XXXXXXX  | XX% | XXXXXXX | XX% | XXXXXX   | X% |
  
 
   
   
### Social Dominance: XXXXX% [#](/topic/bitcoin-cash/social_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: XXXXX%   
**1 Week**: XXXXX% -XXXXX%   
**1 Month**: XXXXX% +0.223%   
**6 Months**: XXXXX% +0.433%   
**1 Year**: XXXXX% +0.193%   
**1-Year High**: XXXXX% on 2025-07-17   
**1-Year Low**: XXXXX% on 2025-05-16   
   
   
### Trading Volume: $XXXXXXXXXXX [#](/topic/bitcoin-cash/volume_24h) 
--- 
**Current Value**: $XXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXX +$4.60%   
**1 Month**: $XXXXXXXXXXX -$20%   
**6 Months**: $XXXXXXXXXXX +$13%   
**1 Year**: $XXXXXXXXXXX +$4.70%   
**1-Year High**: $XXXXXXXXXXXXX on 2024-11-21   
**1-Year Low**: $XXXXXXXXXXX on 2024-08-31   
   
   
### Market Dominance: XXXXX% [#](/topic/bitcoin-cash/market_dominance) 
--- 
**Current Value**: XXXXX%   
**Daily Average**: X%   
**1-Year High**: XXXXX% on 2024-07-30   
**1-Year Low**: XXXXX% on 2025-02-24   
   
   
### Market Cap: $XXXXXXXXXXXXX [#](/topic/bitcoin-cash/market_cap) 
--- 
**Current Value**: $XXXXXXXXXXXXX   
**Daily Average**: $XXXXXXXXXXXXX   
**1 Week**: $XXXXXXXXXXXXX -$3.20%   
**1 Month**: $XXXXXXXXXXXXX +$6.60%   
**6 Months**: $XXXXXXXXXXXXX +$1.20%   
**1 Year**: $XXXXXXXXXXXXX +$30%   
**1-Year High**: $XXXXXXXXXXXXXX on 2024-12-06   
**1-Year Low**: $XXXXXXXXXXXXX on 2025-04-08   
   
   
### Circulating Supply: XXXXXXXXXX [#](/topic/bitcoin-cash/circulating_supply) 
--- 
**Current Value**: XXXXXXXXXX   
**Daily Average**: XXXXXXXXXX   
**1-Year High**: XXXXXXXXXX on 2025-07-17   
**1-Year Low**: XXXXXXXXXX on 2024-07-18

[Cryptocurrencies](/topic/_cryptocurrencies) 
Regulatory developments are underway in the US, with the House passing procedural votes on crypto bills and introducing legislation for bitcoin holdings in mortgages. Additionally, the US government has revealed its current bitcoin stash, and lawmakers are exploring revenue from bitcoin mining. Meanwhile, major institutions, such as Ripple and BlackRock, are expanding their presence in the crypto space. 

Creators: XXXXXXX 
XXXXXXX unique social accounts have posts mentioning Cryptocurrencies in the last XX hours which is down XXXX% from XXXXXXX in the previous XX hours 
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXX -XXXX%   
**1 Month**: XXXXXXXXX +33%   
**6 Months**: XXXXXXXXX -XX%   
**1 Year**: XXXXXXXXX +17%   
**1-Year High**: XXXXXXX on 2024-11-26   
**1-Year Low**: XXXXXXX on 2024-08-11   
 
The most influential creators that mention Cryptocurrencies in the last XX hours 
 
| Creator                                              | Rank | Followers   | Posts | Engagements |
| -------                                              | ---- | ---------   | ----- | ----------- |
| [@MEXC_Listings](/creator/twitter/MEXC_Listings)     | X    | XXXXXXX     | XX    | XXXXXXXXX   |
| [@elonmusk](/creator/twitter/elonmusk)               | X    | XXXXXXXXXXX | X     | XXXXXXXXX   |
| [@BitcoinMagazine](/creator/twitter/BitcoinMagazine) | X    | XXXXXXXXX   | XXX   | XXXXXXXXX   |
| [@mcashlove](/creator/youtube/mcashlove)             | X    | XXXXXXX     | XX    | XXXXXXXXX   |
| [@powerslap](/creator/tiktok/powerslap)              | X    | XXXXXXXXX   | XX    | XXXXXXXXX   |
| [@rovercrc](/creator/twitter/rovercrc)               | X    | XXXXXXXXX   | XXX   | XXXXXXXXX   |
| [@OrchidProtocol](/creator/twitter/OrchidProtocol)   | X    | XXXXXXX     | X     | XXXXXXXXX   |
| [@Vivek4real_](/creator/twitter/Vivek4real_)         | X    | XXXXXXX     | XX    | XXXXXXXXX   |
| [@WatcherGuru](/creator/twitter/WatcherGuru)         | X    | XXXXXXXXX   | XX    | XXXXXXXXX   |
| [@AlexesNakamoto](/creator/twitter/AlexesNakamoto)   | XX   | XXXXX       | X     | XXXXXXXXX   |
 
[View More](/list/creators/_cryptocurrencies/100) 
   
   
Sentiment: XX% 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% +1%   
**6 Months**: XX% -X%   
**1 Year**: XX% -X%   
**1-Year High**: XX% on 2024-08-20   
**1-Year Low**: XX% on 2025-03-19   
 
**Most Supportive Themes** 
- **Bitcoin's Bullish Momentum and Altcoin Developments:** (43%) Bitcoin's positive price movement and the adoption by institutional entities are driving positive sentiment in the market. Technological advancements, partnerships, and exchange listings of altcoins are all contributing to positive sentiment within the crypto community. 
   
**Most Critical Themes** 
- **Centralization and Regulatory Concerns and Security Risks and Illicit Activities:** (15%)  Concerns regarding centralization, regulatory issues, security risks, and illicit activities within the crypto space are being discussed. 
   
Network engagement breakdown:   
| Network | Positive    | %   | Neutral     | %   | Negative   | %   |
| ------- | --------    | -   | -------     | -   | --------   | -   |
| X       | XXXXXXXXXXX | XX% | XXXXXXXXXXX | XX% | XXXXXXXXXX | X%  |
| YouTube | XXXXXXXXXX  | X%  | XXXXXXXXXX  | X%  | XXXXXXXXX  | X%  |
| News    | XXXXXXX     | X%  | XXXXXXX     | X%  | XXXXXX     | X%  |
| Reddit  | XXXXXX      | X%  | XXXXXXX     | X%  | XXXXXX     | X%  |
| TikTok  | XXXXXXXXXX  | X%  | XXXXXXXXXX  | X%  | XXXXXXXXXX | X%  |
|         |             |     |             |     |            |     |
| Total   | XXXXXXXXXXX | XX% | XXXXXXXXXXX | XX% | XXXXXXXXXX | XX% |

[Layer 1](/topic/coins-layer-1) 
The US House has passed a vote to advance key crypto bills, including the Clarity Act, Genius Act, and Anti-CBDC bill, which could shape the future of crypto regulation in America. Meanwhile, Ethereum has broken resistance and is surging, with some analysts predicting it could reach new highs. Additionally, there are updates on Bitcoin adoption, with some companies and governments making significant moves, such as the US Marshals revealing they hold XXXXXX Bitcoin worth $XXX billion. 

Creators: XXXXXXX 
XXXXXXX unique social accounts have posts mentioning Layer X in the last XX hours which is down XXXX% from XXXXXXX in the previous XX hours 
**Daily Average**: XXXXXXX   
**1 Week**: XXXXXXX +1.90%   
**1 Month**: XXXXXXX +51%   
**1-Year High**: XXXXXXX on 2025-07-16   
**1-Year Low**: XXXXXX on 2025-04-19   
 
The most influential creators that mention Layer X in the last XX hours 
 
| Creator                                              | Rank | Followers   | Posts | Engagements |
| -------                                              | ---- | ---------   | ----- | ----------- |
| [@BitcoinMagazine](/creator/twitter/BitcoinMagazine) | X    | XXXXXXXXX   | XXX   | XXXXXXXXX   |
| [@powerslap](/creator/tiktok/powerslap)              | X    | XXXXXXXXX   | XX    | XXXXXXXXX   |
| [@rovercrc](/creator/twitter/rovercrc)               | X    | XXXXXXXXX   | XXX   | XXXXXXXXX   |
| [@elonmusk](/creator/twitter/elonmusk)               | X    | XXXXXXXXXXX | X     | XXXXXXXXX   |
| [@Vivek4real_](/creator/twitter/Vivek4real_)         | X    | XXXXXXX     | XX    | XXXXXXXXX   |
| [@WatcherGuru](/creator/twitter/WatcherGuru)         | X    | XXXXXXXXX   | XX    | XXXXXXXXX   |
| [@AlexesNakamoto](/creator/twitter/AlexesNakamoto)   | X    | XXXXX       | X     | XXXXXXXXX   |
| [@BTC_Archive](/creator/twitter/BTC_Archive)         | X    | XXXXXXXXX   | XX    | XXXXXXXXX   |
| [@eToro](/creator/twitter/eToro)                     | X    | XXXXXXX     | X     | XXXXXXXXX   |
| [@yeti.solana](/creator/tiktok/yeti.solana)          | XX   | XXXXXX      | XX    | XXXXXXXXX   |
 
[View More](/list/creators/coins-layer-1/100) 
   
   
Sentiment: XX% 
**Current Value**: XX%   
**Daily Average**: XX%   
**1 Week**: XX% no change   
**1 Month**: XX% no change   
**1-Year High**: XX% on 2025-06-29   
**1-Year Low**: XX% on 2025-04-08   
 
**Most Supportive Themes** 
- **Bitcoin's Continued Strength and Institutional Adoption:** (45%) Posts highlighting Bitcoin's all-time highs, institutional investment, and its potential as a store of value. 
- **Solana's Growing Ecosystem and Technological Advancements:** (25%) Posts celebrating Solana's ecosystem growth, including increased DeFi activity, tokenized equities, and innovative projects. 
- **Ethereum's Ongoing Development and Layer X Solutions:** (20%) Posts emphasizing Ethereum's upgrades and its role in global financial freedom. 
   
**Most Critical Themes** 
- **Centralization Concerns and Protocol Limitations:** (9%)  Concerns about centralization and protocol limitations within Layer X blockchains. 
   
Network engagement breakdown:   
| Network | Positive    | %   | Neutral     | %   | Negative   | %   |
| ------- | --------    | -   | -------     | -   | --------   | -   |
| YouTube | XXXXXXXXX   | X%  | XXXXXXXXXX  | X%  | XXXXXXXXX  | X%  |
| X       | XXXXXXXXXX  | XX% | XXXXXXXXXX  | XX% | XXXXXXXXXX | X%  |
| TikTok  | XXXXXXXXX   | X%  | XXXXXXXXXX  | X%  | XXXXXXXXX  | X%  |
| Reddit  | XXXXXX      | X%  | XXXXXXX     | X%  | XXXXXX     | X%  |
| News    | XXXXXXX     | X%  | XXXXXXX     | X%  | XXXXXX     | X%  |
|         |             |     |             |     |            |     |
| Total   | XXXXXXXXXXX | XX% | XXXXXXXXXXX | XX% | XXXXXXXXXX | XX% |